The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8901310, Comparator J ID: ALA3647448
PubChem CID: 89574668
Max Phase: Preclinical
Molecular Formula: C31H34F3N3O2
Molecular Weight: 537.63
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ncc(NC(=O)c2ccc3c(c2)CC[C@@H]2C[C@@](O)(CCC(F)(F)F)CC[C@@]32Cc2ccccc2)c(C)n1
Standard InChI: InChI=1S/C31H34F3N3O2/c1-20-27(19-35-21(2)36-20)37-28(38)24-9-11-26-23(16-24)8-10-25-18-29(39,13-15-31(32,33)34)12-14-30(25,26)17-22-6-4-3-5-7-22/h3-7,9,11,16,19,25,39H,8,10,12-15,17-18H2,1-2H3,(H,37,38)/t25-,29+,30+/m1/s1
Standard InChI Key: XNVXVNJRQLVPBF-CPESWEKQSA-N
Molfile:
RDKit 2D
39 43 0 0 1 0 0 0 0 0999 V2000
7.5307 -5.8571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4915 -5.2571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4915 -3.7571 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1925 -3.0070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8933 -3.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6375 -0.9049 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1962 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1962 3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1668 4.1996 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.4596 2.2284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4603 0.7276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7599 -0.0231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7604 -1.2231 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-8.7993 -0.6228 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-8.7990 0.5770 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 3.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2983 2.2504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2974 3.7512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0006 4.5032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0015 6.0032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3016 6.7513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5996 5.9995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5975 4.4995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8934 -5.2570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8542 -5.8570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1924 -6.0070 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 1 0
7 8 2 0
7 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 1 0
14 15 1 0
16 15 1 6
16 17 1 0
17 18 1 0
18 19 1 6
18 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
22 24 1 0
22 25 1 0
18 26 1 0
26 27 1 0
27 28 1 0
28 12 1 0
28 16 1 0
28 29 1 6
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
13 36 2 0
36 9 1 0
5 37 1 0
37 38 1 0
37 39 2 0
39 2 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 537.63Molecular Weight (Monoisotopic): 537.2603AlogP: 6.65#Rotatable Bonds: 6Polar Surface Area: 75.11Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 2.80CX LogP: 5.93CX LogD: 5.93Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.37Np Likeness Score: 0.02
References 1. (2014) Tricyclic compounds, compositions, and methods,