US8901310, Comparator J

ID: ALA3647448

PubChem CID: 89574668

Max Phase: Preclinical

Molecular Formula: C31H34F3N3O2

Molecular Weight: 537.63

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ncc(NC(=O)c2ccc3c(c2)CC[C@@H]2C[C@@](O)(CCC(F)(F)F)CC[C@@]32Cc2ccccc2)c(C)n1

Standard InChI:  InChI=1S/C31H34F3N3O2/c1-20-27(19-35-21(2)36-20)37-28(38)24-9-11-26-23(16-24)8-10-25-18-29(39,13-15-31(32,33)34)12-14-30(25,26)17-22-6-4-3-5-7-22/h3-7,9,11,16,19,25,39H,8,10,12-15,17-18H2,1-2H3,(H,37,38)/t25-,29+,30+/m1/s1

Standard InChI Key:  XNVXVNJRQLVPBF-CPESWEKQSA-N

Molfile:  

     RDKit          2D

 39 43  0  0  1  0  0  0  0  0999 V2000
    7.5307   -5.8571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4915   -5.2571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4915   -3.7571    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1925   -3.0070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8933   -3.7570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5951   -3.0039    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6375   -0.9049    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1962    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1962    3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1668    4.1996    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4596    2.2284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4603    0.7276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7599   -0.0231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7604   -1.2231    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -8.7993   -0.6228    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -8.7990    0.5770    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971    3.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2983    2.2504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2974    3.7512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0006    4.5032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0015    6.0032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3016    6.7513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5996    5.9995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5975    4.4995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8934   -5.2570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8542   -5.8570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1924   -6.0070    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  7  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 16 15  1  6
 16 17  1  0
 17 18  1  0
 18 19  1  6
 18 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 22 24  1  0
 22 25  1  0
 18 26  1  0
 26 27  1  0
 27 28  1  0
 28 12  1  0
 28 16  1  0
 28 29  1  6
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
 13 36  2  0
 36  9  1  0
  5 37  1  0
 37 38  1  0
 37 39  2  0
 39  2  1  0
M  END

Alternative Forms

  1. Parent:

Associated Targets(Human)

NR3C1 Tclin Glucocorticoid receptor (14987 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
IL6 Tclin Interleukin-6 (43 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 537.63Molecular Weight (Monoisotopic): 537.2603AlogP: 6.65#Rotatable Bonds: 6
Polar Surface Area: 75.11Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 2.80CX LogP: 5.93CX LogD: 5.93
Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.37Np Likeness Score: 0.02

References

1.  (2014)  Tricyclic compounds, compositions, and methods, 

Source

Source(1):