The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
BOC-LYS(AC)-AMC::US8476255, 76 ID: ALA3647939
PubChem CID: 25264193
Max Phase: Preclinical
Molecular Formula: C26H23FN2O3S
Molecular Weight: 462.55
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CSc1ccc(/C=C(/C(=O)NCc2ccc(/C=C/C(=O)NO)cc2)c2ccc(F)cc2)cc1
Standard InChI: InChI=1S/C26H23FN2O3S/c1-33-23-13-6-19(7-14-23)16-24(21-9-11-22(27)12-10-21)26(31)28-17-20-4-2-18(3-5-20)8-15-25(30)29-32/h2-16,32H,17H2,1H3,(H,28,31)(H,29,30)/b15-8+,24-16+
Standard InChI Key: DVHRFNSGDJIRSJ-SQTMOLFMSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
2.5956 -2.7031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6003 1.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8990 0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2003 1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2024 2.6932 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.4990 0.7409 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-7.8003 1.4887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0990 0.7364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.4007 1.4818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.6971 0.7273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.6919 -0.7727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.9875 -1.5302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.9802 -3.0311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-14.2758 -3.7886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-15.3181 -3.1941 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-14.2684 -5.2894 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-15.3043 -5.8952 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-10.3903 -1.5182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0939 -0.7637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8964 -0.7553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1931 -1.5094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1885 -3.0094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8871 -3.7554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8834 -4.9554 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.5904 -3.0014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5951 -1.5014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
9 11 1 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
19 21 1 0
21 22 1 0
16 23 1 0
23 24 2 0
24 13 1 0
8 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
28 30 1 0
30 31 2 0
31 25 1 0
6 32 1 0
32 33 2 0
33 3 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 462.55Molecular Weight (Monoisotopic): 462.1413AlogP: 4.92#Rotatable Bonds: 8Polar Surface Area: 78.43Molecular Species: NEUTRALHBA: 4HBD: 3#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.56CX Basic pKa: ┄CX LogP: 5.07CX LogD: 5.07Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.15Np Likeness Score: -0.85
References 1. (2013) Histone deacetylase inhibitors,