The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8476255, 77 ID: ALA3647940
PubChem CID: 25264194
Max Phase: Preclinical
Molecular Formula: C27H25FN2O5
Molecular Weight: 476.50
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(/C=C(/C(=O)NCc2ccc(/C=C/C(=O)NO)cc2)c2ccc(F)cc2)cc1OC
Standard InChI: InChI=1S/C27H25FN2O5/c1-34-24-13-7-20(16-25(24)35-2)15-23(21-9-11-22(28)12-10-21)27(32)29-17-19-5-3-18(4-6-19)8-14-26(31)30-33/h3-16,33H,17H2,1-2H3,(H,29,32)(H,30,31)/b14-8+,23-15+
Standard InChI Key: DBTQBONKZBXAAE-QLOONLQOSA-N
Molfile:
RDKit 2D
35 37 0 0 0 0 0 0 0 0999 V2000
3.6387 -0.8963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6003 1.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8990 0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2003 1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2024 2.6932 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.4990 0.7409 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-7.8003 1.4887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0990 0.7364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.4007 1.4818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.6971 0.7273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.6919 -0.7727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.9875 -1.5302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.9802 -3.0311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-14.2758 -3.7886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-15.3181 -3.1941 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-14.2684 -5.2894 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-15.3043 -5.8952 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-10.3903 -1.5182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0939 -0.7637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8964 -0.7553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1931 -1.5094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1885 -3.0094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8871 -3.7554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8834 -4.9554 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.5904 -3.0014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5951 -1.5014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0031 -3.0008 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0432 -3.5994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
9 11 1 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
19 21 1 0
21 22 1 0
16 23 1 0
23 24 2 0
24 13 1 0
8 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
28 30 1 0
30 31 2 0
31 25 1 0
6 32 1 0
32 33 2 0
33 3 1 0
33 34 1 0
34 35 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 476.50Molecular Weight (Monoisotopic): 476.1748AlogP: 4.22#Rotatable Bonds: 9Polar Surface Area: 96.89Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.56CX Basic pKa: ┄CX LogP: 4.13CX LogD: 4.12Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.19Np Likeness Score: -0.52
References 1. (2013) Histone deacetylase inhibitors,