The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8476255, 84 ID: ALA3647941
PubChem CID: 59475052
Max Phase: Preclinical
Molecular Formula: C23H27FN2O3S
Molecular Weight: 430.55
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CSc1ccc(/C=C(/C(=O)NCCCCCCC(=O)NO)c2ccc(F)cc2)cc1
Standard InChI: InChI=1S/C23H27FN2O3S/c1-30-20-13-7-17(8-14-20)16-21(18-9-11-19(24)12-10-18)23(28)25-15-5-3-2-4-6-22(27)26-29/h7-14,16,29H,2-6,15H2,1H3,(H,25,28)(H,26,27)/b21-16+
Standard InChI Key: UWOLQCFZNNRZKN-LTGZKZEYSA-N
Molfile:
RDKit 2D
30 31 0 0 0 0 0 0 0 0999 V2000
2.5956 -2.7031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6003 1.4978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8991 0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1982 1.4970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2377 0.8976 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.1978 2.9978 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.4969 3.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4966 5.2502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7957 6.0017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7953 7.5025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0944 8.2541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0941 9.7549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.3932 10.5064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.4327 9.9070 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-10.3928 12.0073 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-11.4315 12.6082 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8977 -0.7554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6002 -1.5079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6030 -3.0079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9035 -3.7554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9058 -4.9554 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-5.2011 -3.0029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1982 -1.5029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
9 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 2 0
18 20 1 0
20 21 1 0
8 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
25 27 1 0
27 28 2 0
28 22 1 0
6 29 1 0
29 30 2 0
30 3 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 430.55Molecular Weight (Monoisotopic): 430.1726AlogP: 4.66#Rotatable Bonds: 11Polar Surface Area: 78.43Molecular Species: NEUTRALHBA: 4HBD: 3#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.91CX Basic pKa: ┄CX LogP: 4.52CX LogD: 4.51Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.12Np Likeness Score: -0.80
References 1. (2013) Histone deacetylase inhibitors,