The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8552202, Compound 14 ID: ALA3648412
PubChem CID: 58101961
Max Phase: Preclinical
Molecular Formula: C24H27ClN4O4
Molecular Weight: 470.96
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(N[C@H](C(=O)N1C[C@@H](Cl)[C@H]2OCC(=O)[C@H]21)C1CCCCC1)c1cccc(-n2ccnc2)c1
Standard InChI: InChI=1S/C24H27ClN4O4/c25-18-12-29(21-19(30)13-33-22(18)21)24(32)20(15-5-2-1-3-6-15)27-23(31)16-7-4-8-17(11-16)28-10-9-26-14-28/h4,7-11,14-15,18,20-22H,1-3,5-6,12-13H2,(H,27,31)/t18-,20+,21-,22-/m1/s1
Standard InChI Key: JPQIXMPQVCDFBY-FVTFTPSCSA-N
Molfile:
RDKit 2D
33 37 0 0 1 0 0 0 0 0999 V2000
1.4553 -2.0031 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
0.7500 -1.0323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2135 0.3943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.2760 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2135 0.3943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7500 -1.0323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9615 -1.9133 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.1750 -1.0316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7115 0.3949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4167 1.3659 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0031 2.7742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0351 3.3760 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3039 3.5228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3070 5.0236 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6079 5.7721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6460 5.1703 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6110 7.2730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9100 8.0230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9101 9.5230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6111 10.2731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3120 9.5231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3119 8.0231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0123 10.2735 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.1278 11.7542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5955 12.0638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3435 10.7636 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3381 9.6504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6023 2.7701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9038 3.5160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2005 2.7620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1958 1.2620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8944 0.5160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5977 1.2701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 1
2 3 1 0
3 4 1 0
5 4 1 1
5 6 1 0
6 2 1 0
6 7 1 1
7 8 1 0
8 9 1 0
9 5 1 0
9 10 2 0
4 11 1 0
11 12 2 0
11 13 1 0
13 14 1 1
14 15 1 0
15 16 2 0
15 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
21 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 23 1 0
13 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 470.96Molecular Weight (Monoisotopic): 470.1721AlogP: 2.34#Rotatable Bonds: 5Polar Surface Area: 93.53Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 6.05CX LogP: 2.54CX LogD: 2.53Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.68Np Likeness Score: -0.80
References 1. (2013) Furo[3, 2-B] pyrrol-3-ones as cathespin S inhibitors,