The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8901315, 380 ID: ALA3650326
PubChem CID: 57698197
Max Phase: Preclinical
Molecular Formula: C24H30N6O2S
Molecular Weight: 466.61
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1nn(C2CCCCC2)c2sc(C(=O)Nc3ccc(C(=O)N4CCN(C)CC4)nc3)cc12
Standard InChI: InChI=1S/C24H30N6O2S/c1-16-19-14-21(33-24(19)30(27-16)18-6-4-3-5-7-18)22(31)26-17-8-9-20(25-15-17)23(32)29-12-10-28(2)11-13-29/h8-9,14-15,18H,3-7,10-13H2,1-2H3,(H,26,31)
Standard InChI Key: CURDUNQAXIVPBS-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
10.2113 -7.8598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0183 -7.9893 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.4129 -9.3617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9216 -9.5236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0357 -8.3131 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6412 -6.9407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1324 -6.7788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5433 -8.4720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0571 -9.5691 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6587 -7.2596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1669 -7.4164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2853 -6.2028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8954 -4.8324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0157 -3.6164 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.6281 -2.2462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8218 -2.1229 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7500 -1.0323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2135 0.3943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.2760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4623 2.7009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2432 3.6715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9623 2.7008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.4258 1.2743 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.8530 0.8102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0359 1.7245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4234 1.1545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.6235 -0.3321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4362 -1.2487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0487 -0.6787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2135 0.3943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7500 -1.0323 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.3872 -4.6758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2689 -5.8893 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 2 1 0
5 8 1 0
8 9 2 0
8 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 1 0
15 16 2 0
15 17 1 0
17 18 2 0
18 19 1 0
19 20 1 0
20 21 1 0
20 22 2 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 24 1 0
23 30 1 0
30 19 2 0
30 31 1 0
31 17 1 0
13 32 1 0
32 33 2 0
33 10 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 466.61Molecular Weight (Monoisotopic): 466.2151AlogP: 3.95#Rotatable Bonds: 4Polar Surface Area: 83.36Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.76CX Basic pKa: 6.69CX LogP: 3.02CX LogD: 2.95Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.63Np Likeness Score: -2.10
References 1. (2014) Thienopyrazole derivative having PDE7 inhibitory activity,