The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8901315, 381 ID: ALA3650327
PubChem CID: 57697977
Max Phase: Preclinical
Molecular Formula: C23H30N6O2S
Molecular Weight: 454.60
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1nn(C2CCCCC2)c2sc(C(=O)Nc3ccc(C(=O)NCCN(C)C)nc3)cc12
Standard InChI: InChI=1S/C23H30N6O2S/c1-15-18-13-20(32-23(18)29(27-15)17-7-5-4-6-8-17)22(31)26-16-9-10-19(25-14-16)21(30)24-11-12-28(2)3/h9-10,13-14,17H,4-8,11-12H2,1-3H3,(H,24,30)(H,26,31)
Standard InChI Key: LYEXMIMGSCSUOB-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
10.4906 -10.4519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2973 -10.5790 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.8111 -11.6760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4127 -9.3665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9203 -9.5255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0357 -8.3131 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.5433 -8.4720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0571 -9.5691 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6587 -7.2596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1669 -7.4164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2853 -6.2028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8954 -4.8324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0157 -3.6164 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.6281 -2.2462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8218 -2.1229 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7500 -1.0323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2135 0.3943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.2760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4623 2.7009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2432 3.6715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9623 2.7008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.4258 1.2743 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.8530 0.8102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0359 1.7245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4234 1.1545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.6235 -0.3321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4362 -1.2487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0487 -0.6787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2135 0.3943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7500 -1.0323 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.3872 -4.6758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2689 -5.8893 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 2 0
7 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 1 0
14 15 2 0
14 16 1 0
16 17 2 0
17 18 1 0
18 19 1 0
19 20 1 0
19 21 2 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 23 1 0
22 29 1 0
29 18 2 0
29 30 1 0
30 16 1 0
12 31 1 0
31 32 2 0
32 9 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 454.60Molecular Weight (Monoisotopic): 454.2151AlogP: 3.85#Rotatable Bonds: 7Polar Surface Area: 92.15Molecular Species: BASEHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.69CX Basic pKa: 8.51CX LogP: 2.97CX LogD: 1.83Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.57Np Likeness Score: -2.09
References 1. (2014) Thienopyrazole derivative having PDE7 inhibitory activity,