The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8901315, 383 ID: ALA3650329
PubChem CID: 57697931
Max Phase: Preclinical
Molecular Formula: C25H32N6O2S
Molecular Weight: 480.64
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1nn(C2CCCCC2)c2sc(C(=O)Nc3ccc(C(=O)N4CCCN(C)CC4)nc3)cc12
Standard InChI: InChI=1S/C25H32N6O2S/c1-17-20-15-22(34-25(20)31(28-17)19-7-4-3-5-8-19)23(32)27-18-9-10-21(26-16-18)24(33)30-12-6-11-29(2)13-14-30/h9-10,15-16,19H,3-8,11-14H2,1-2H3,(H,27,32)
Standard InChI Key: FVHBSGBINYXLKC-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
10.2567 -6.5767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2381 -7.2110 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.3999 -8.7023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3350 -9.7586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8451 -9.5846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0357 -8.3131 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5534 -6.8975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9712 -6.4078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5433 -8.4720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0571 -9.5691 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6587 -7.2596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1669 -7.4164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2853 -6.2028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8954 -4.8324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0157 -3.6164 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.6281 -2.2462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8218 -2.1229 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7500 -1.0323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2135 0.3943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.2760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4623 2.7009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2432 3.6715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9623 2.7008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.4258 1.2743 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.8530 0.8102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0359 1.7245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4234 1.1545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.6235 -0.3321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4362 -1.2487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0487 -0.6787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2135 0.3943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7500 -1.0323 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.3872 -4.6758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2689 -5.8893 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 2 1 0
6 9 1 0
9 10 2 0
9 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 1 0
16 17 2 0
16 18 1 0
18 19 2 0
19 20 1 0
20 21 1 0
21 22 1 0
21 23 2 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 25 1 0
24 31 1 0
31 20 2 0
31 32 1 0
32 18 1 0
14 33 1 0
33 34 2 0
34 11 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 480.64Molecular Weight (Monoisotopic): 480.2307AlogP: 4.34#Rotatable Bonds: 4Polar Surface Area: 83.36Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.76CX Basic pKa: 7.71CX LogP: 3.08CX LogD: 2.60Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.60Np Likeness Score: -2.12
References 1. (2014) Thienopyrazole derivative having PDE7 inhibitory activity,