The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8901315, 396 ID: ALA3650331
PubChem CID: 57698142
Max Phase: Preclinical
Molecular Formula: C23H35N5O4S2
Molecular Weight: 509.70
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1nn(C2CCOCC2)c2sc(C(=O)N[C@H]3CC[C@H](N4CCN(S(C)(=O)=O)CC4)CC3)cc12
Standard InChI: InChI=1S/C23H35N5O4S2/c1-16-20-15-21(33-23(20)28(25-16)19-7-13-32-14-8-19)22(29)24-17-3-5-18(6-4-17)26-9-11-27(12-10-26)34(2,30)31/h15,17-19H,3-14H2,1-2H3,(H,24,29)/t17-,18-
Standard InChI Key: JZDLORHEVVJQCL-IYARVYRRSA-N
Molfile:
RDKit 2D
34 38 0 0 1 0 0 0 0 0999 V2000
1.4553 -2.0031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7500 -1.0323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2135 0.3943 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.2760 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 2.7767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2353 3.6188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1224 5.1146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2294 5.7647 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4683 4.9191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3554 3.4233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2135 0.3943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7115 0.3949 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.1750 -1.0317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9615 -1.9133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7500 -1.0323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5990 -1.4976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4922 -0.6962 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.9089 -2.9661 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.3353 -3.4328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.6472 -4.9001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.0738 -5.3637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.1885 -4.3600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.8767 -2.8928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.4502 -2.4292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.6158 -4.8239 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-11.7323 -3.8220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-13.1581 -4.2879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-13.4676 -5.7556 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-12.3512 -6.7575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.9254 -6.2916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-14.8942 -6.2217 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-15.7878 -5.4208 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-15.1414 -7.3960 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-16.0347 -6.5949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 5 1 0
4 11 1 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 2 1 0
15 11 2 0
13 16 1 0
16 17 2 0
16 18 1 0
19 18 1 6
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 19 1 0
22 25 1 1
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 25 1 0
28 31 1 0
31 32 2 0
31 33 2 0
31 34 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 509.70Molecular Weight (Monoisotopic): 509.2130AlogP: 2.38#Rotatable Bonds: 5Polar Surface Area: 96.77Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 7.18CX LogP: 0.55CX LogD: 0.34Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.66Np Likeness Score: -1.96
References 1. (2014) Thienopyrazole derivative having PDE7 inhibitory activity,