The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8901315, 425 ID: ALA3650342
PubChem CID: 57698273
Max Phase: Preclinical
Molecular Formula: C23H34N4O3S
Molecular Weight: 446.62
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1nn(C2CCOCC2)c2sc(C(=O)N[C@H]3CC[C@H](N4CCC(O)CC4)CC3)cc12
Standard InChI: InChI=1S/C23H34N4O3S/c1-15-20-14-21(31-23(20)27(25-15)18-8-12-30-13-9-18)22(29)24-16-2-4-17(5-3-16)26-10-6-19(28)7-11-26/h14,16-19,28H,2-13H2,1H3,(H,24,29)/t16-,17-
Standard InChI Key: NLOVQPSKQWMMJU-QAQDUYKDSA-N
Molfile:
RDKit 2D
31 35 0 0 1 0 0 0 0 0999 V2000
1.4553 -2.0031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7500 -1.0323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2135 0.3943 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.2760 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 2.7767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2353 3.6188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1224 5.1146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2294 5.7647 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4683 4.9191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3554 3.4233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2135 0.3943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7115 0.3949 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.1750 -1.0317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9615 -1.9133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7500 -1.0323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5990 -1.4976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4922 -0.6962 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.9089 -2.9661 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.3353 -3.4328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.6472 -4.9001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.0738 -5.3637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.1885 -4.3600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.8767 -2.8928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.4502 -2.4292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.6158 -4.8239 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-11.7323 -3.8220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-13.1581 -4.2879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-13.4676 -5.7556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-14.6082 -6.1283 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-12.3512 -6.7575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.9254 -6.2916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 5 1 0
4 11 1 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 2 1 0
15 11 2 0
13 16 1 0
16 17 2 0
16 18 1 0
19 18 1 6
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 19 1 0
22 25 1 1
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
28 30 1 0
30 31 1 0
31 25 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 446.62Molecular Weight (Monoisotopic): 446.2352AlogP: 3.26#Rotatable Bonds: 4Polar Surface Area: 79.62Molecular Species: BASEHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.57CX LogP: 1.29CX LogD: -0.85Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.75Np Likeness Score: -1.46
References 1. (2014) Thienopyrazole derivative having PDE7 inhibitory activity,