US8481536, 452::US8481536, 598

ID: ALA3651212

PubChem CID: 11583382

Max Phase: Preclinical

Molecular Formula: C27H28FN5O

Molecular Weight: 457.55

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccc(F)cc1-c1cc2nnc(Nc3ccc(OCCN4CCCC4)cc3)nc2cc1C

Standard InChI:  InChI=1S/C27H28FN5O/c1-18-5-6-20(28)16-23(18)24-17-26-25(15-19(24)2)30-27(32-31-26)29-21-7-9-22(10-8-21)34-14-13-33-11-3-4-12-33/h5-10,15-17H,3-4,11-14H2,1-2H3,(H,29,30,32)

Standard InChI Key:  PWKWAGIBTGYEHC-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
    3.9010    0.4475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8991   -0.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1969   -1.5045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1945   -3.0045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8943   -3.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8924   -4.9525    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.5965   -3.0004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5987   -1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2991    3.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8994    3.7477    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1981    2.9954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4998    3.7409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7962    2.9864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7910    1.4864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0866    0.7288    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0793   -0.7720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.3749   -1.5296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.3675   -3.0304    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  -11.5750   -3.8986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.1016   -5.3219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.6016   -5.3115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.1480   -3.8818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4894    0.7409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1930    1.4954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    1.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -2.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  5  7  1  0
  7  8  2  0
  8  2  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 23  1  0
 19 28  1  0
 28 29  2  0
 29 16  1  0
 14 30  1  0
 30 31  2  0
 31 11  1  0
 31 32  1  0
 32 33  2  0
 33  9  1  0
 33 34  1  0
M  END

Associated Targets(Human)

PDGFRB Tclin Platelet-derived growth factor receptor beta (5195 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SRC Tclin Tyrosine-protein kinase SRC (10310 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 457.55Molecular Weight (Monoisotopic): 457.2278AlogP: 5.67#Rotatable Bonds: 7
Polar Surface Area: 63.17Molecular Species: BASEHBA: 6HBD: 1
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.01CX Basic pKa: 9.03CX LogP: 6.03CX LogD: 4.40
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.39Np Likeness Score: -1.47

References

1.  (2013)  Benzotriazine inhibitors of kinases, 
2.  (2008)  Benzotriazine inhibitors of kinases,