The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8481536, 496::US8481536, 610 ID: ALA3651249
PubChem CID: 59837748
Max Phase: Preclinical
Molecular Formula: C23H21ClN6O2
Molecular Weight: 448.91
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(-c2cc(O)ccc2Cl)cc2nnc(Nc3ccc(N4CCOCC4)nc3)nc12
Standard InChI: InChI=1S/C23H21ClN6O2/c1-14-10-15(18-12-17(31)3-4-19(18)24)11-20-22(14)27-23(29-28-20)26-16-2-5-21(25-13-16)30-6-8-32-9-7-30/h2-5,10-13,31H,6-9H2,1H3,(H,26,27,29)
Standard InChI Key: NYBNNHFUSGTOBH-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
2.3383 -1.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -3.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -3.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2959 -5.2508 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0049 -5.9994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0102 -7.4994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3118 -8.2449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6082 -7.4904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6030 -5.9904 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3014 -5.2449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9105 -8.2363 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9182 -9.7363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2210 -10.4798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5162 -9.7232 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5087 -8.2232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2059 -7.4798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -3.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3002 3.7488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3026 5.2488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3428 5.8472 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0048 6.0009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2954 5.2529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2978 3.7529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3380 3.1546 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
14 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 17 1 0
9 23 1 0
23 24 2 0
24 2 1 0
24 6 1 0
4 25 1 0
25 26 2 0
26 27 1 0
27 28 1 0
27 29 2 0
29 30 1 0
30 31 2 0
31 25 1 0
31 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 448.91Molecular Weight (Monoisotopic): 448.1415AlogP: 4.33#Rotatable Bonds: 4Polar Surface Area: 96.29Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.85CX Basic pKa: 6.18CX LogP: 4.68CX LogD: 4.64Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.48Np Likeness Score: -1.59
References 1. (2013) Benzotriazine inhibitors of kinases, 2. (2008) Benzotriazine inhibitors of kinases,