US8524716, 20

ID: ALA3651543

PubChem CID: 44129499

Max Phase: Preclinical

Molecular Formula: C29H33ClN4O4S

Molecular Weight: 569.13

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN1C/C=C\CCNC(=O)Cn2c(-c3ccc(Cl)cc3)c(C3CCCCC3)c3ccc(cc32)C(=O)NS1(=O)=O

Standard InChI:  InChI=1S/C29H33ClN4O4S/c1-33-17-7-3-6-16-31-26(35)19-34-25-18-22(29(36)32-39(33,37)38)12-15-24(25)27(20-8-4-2-5-9-20)28(34)21-10-13-23(30)14-11-21/h3,7,10-15,18,20H,2,4-6,8-9,16-17,19H2,1H3,(H,31,35)(H,32,36)/b7-3-

Standard InChI Key:  UCIHRYYKKPPEQP-CLTKARDFSA-N

Molfile:  

     RDKit          2D

 39 43  0  0  0  0  0  0  0  0999 V2000
    3.5669    3.5669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7184    2.7184    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4712    3.5517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.8444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4712    3.5517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7184    2.7184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5517    1.4712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8444    0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5517   -1.4712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6604   -1.9304    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7184   -2.7184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4712   -3.5517    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2053   -4.8667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6956   -5.0441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6773   -3.9165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1493   -4.2047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6358   -5.6236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8134   -5.8541    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -5.6502   -6.7543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1781   -6.4661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1871   -5.9682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4799   -7.4401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8558   -8.0250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0369   -9.5140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8379  -10.4154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4578   -9.8277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2767   -8.3387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1751   -5.3402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8885   -5.7933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9765   -4.7608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7184   -2.7184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4712   -3.5517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -3.8444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5517   -1.4712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6604   -1.9304    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8444    0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.5517    1.4712    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.6437    2.6677    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4628    0.6902    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
  9 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 17 19  1  0
 19 20  2  0
 20 14  1  0
 13 21  2  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 22  1  0
 21 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 12  1  0
 33 28  1  0
 31 34  1  0
 34 35  2  0
 34 36  1  0
 36 37  1  0
 37  2  1  0
 37 38  2  0
 37 39  2  0
M  END

Associated Targets(non-human)

Genome polyprotein (55 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 569.13Molecular Weight (Monoisotopic): 568.1911AlogP: 4.99#Rotatable Bonds: 2
Polar Surface Area: 100.51Molecular Species: ACIDHBA: 5HBD: 2
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 4.15CX Basic pKa: CX LogP: 4.45CX LogD: 3.51
Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.43Np Likeness Score: -0.22

References

1.  (2013)  Macrocyclic indoles as hepatitis C virus inhibitors, 

Source

Source(1):