US8524716, 23

ID: ALA3651544

PubChem CID: 59549092

Max Phase: Preclinical

Molecular Formula: C29H33ClN4O4S

Molecular Weight: 569.13

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN1C/C=C\CN(C)S(=O)(=O)NC(=O)c2ccc3c(C4CCCCC4)c(-c4ccc(Cl)cc4)n(c3c2)CC1=O

Standard InChI:  InChI=1S/C29H33ClN4O4S/c1-32-16-6-7-17-33(2)39(37,38)31-29(36)22-12-15-24-25(18-22)34(19-26(32)35)28(21-10-13-23(30)14-11-21)27(24)20-8-4-3-5-9-20/h6-7,10-15,18,20H,3-5,8-9,16-17,19H2,1-2H3,(H,31,36)/b7-6-

Standard InChI Key:  UEDANJNSPPDNGK-SREVYHEPSA-N

Molfile:  

     RDKit          2D

 39 43  0  0  0  0  0  0  0  0999 V2000
    3.5725    3.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6807    2.4138    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4672    3.2954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.6073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4672    3.2954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6808    2.4137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4308    1.1147    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5720    1.4855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5875   -0.3771    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2406    0.6296    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0170   -1.4976    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1240   -1.8037    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1203   -2.9184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8256   -3.8892    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7500   -3.5285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9277   -1.8834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1870   -0.8797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6136   -1.3433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0080   -0.1656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2983    1.1567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1633    1.4443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6472    2.8640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3404    3.9931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8119    3.7023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2959    2.2825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4566   -0.5548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7560    0.1962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9935    1.6666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3962    2.1981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5578    1.2490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6800    1.6742    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    7.3167   -0.2315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9140   -0.7629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1240   -1.8036    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.5875   -0.3771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4307    1.1147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5720    1.4855    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1203   -2.9184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7500   -3.5285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  7  9  1  0
  9 10  2  0
  9 11  2  0
  9 12  1  0
 12 13  1  0
 13 14  2  0
 13 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 20  1  0
 19 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 30 32  1  0
 32 33  2  0
 33 27  1  0
 26 34  1  0
 34 35  1  0
 35 36  1  0
 36  2  1  0
 36 37  2  0
 34 38  1  0
 38 18  1  0
 38 39  2  0
 39 15  1  0
M  END

Associated Targets(non-human)

Genome polyprotein (55 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 569.13Molecular Weight (Monoisotopic): 568.1911AlogP: 4.94#Rotatable Bonds: 2
Polar Surface Area: 91.72Molecular Species: ACIDHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 4.15CX Basic pKa: CX LogP: 4.38CX LogD: 3.44
Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.44Np Likeness Score: -0.30

References

1.  (2013)  Macrocyclic indoles as hepatitis C virus inhibitors, 

Source

Source(1):