The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8524716, 1 ID: ALA3651546
PubChem CID: 44129185
Max Phase: Preclinical
Molecular Formula: C27H31N3O3
Molecular Weight: 445.56
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C1Cn2c(-c3ccoc3)c(C3CCCCC3)c3ccc(cc32)C(=O)NCC/C=C\CCN1
Standard InChI: InChI=1S/C27H31N3O3/c31-24-17-30-23-16-20(27(32)29-14-7-2-1-6-13-28-24)10-11-22(23)25(19-8-4-3-5-9-19)26(30)21-12-15-33-18-21/h1-2,10-12,15-16,18-19H,3-9,13-14,17H2,(H,28,31)(H,29,32)/b2-1-
Standard InChI Key: FTPUPIQUARNDAE-UPHRSURJSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
3.5725 3.2167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6807 2.4138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4672 3.2954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 3.6073 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.1555 5.1049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4547 5.8561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8460 5.3439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7592 6.5339 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9097 7.7701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4714 7.3442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2148 5.7150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5268 7.1830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4936 8.2635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9150 9.7031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3724 10.0580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4084 8.9732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9870 7.5336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2185 4.6003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9824 4.2735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5371 2.8798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4308 1.1147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6808 2.4137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4672 3.2954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5875 -0.3771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7810 -0.5025 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.1240 -1.8037 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.1203 -2.9184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7500 -3.5285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7500 -3.5285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1203 -2.9184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1240 -1.8036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5875 -0.3771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4307 1.1147 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 1 0
9 10 2 0
10 6 1 0
5 11 2 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 12 1 0
11 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 4 1 0
23 18 1 0
21 24 1 0
24 25 2 0
24 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 1 0
32 33 1 0
33 2 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 445.56Molecular Weight (Monoisotopic): 445.2365AlogP: 5.15#Rotatable Bonds: 2Polar Surface Area: 76.27Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.02CX LogD: 4.02Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.54Np Likeness Score: 0.26
References 1. (2013) Macrocyclic indoles as hepatitis C virus inhibitors,