US8524716, 8

ID: ALA3651550

PubChem CID: 44129258

Max Phase: Preclinical

Molecular Formula: C29H35N3O3

Molecular Weight: 473.62

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C1Cn2c(-c3ccc(O)cc3)c(C3CCCCC3)c3ccc(cc32)C(=O)NCCCCCCN1

Standard InChI:  InChI=1S/C29H35N3O3/c33-23-13-10-21(11-14-23)28-27(20-8-4-3-5-9-20)24-15-12-22-18-25(24)32(28)19-26(34)30-16-6-1-2-7-17-31-29(22)35/h10-15,18,20,33H,1-9,16-17,19H2,(H,30,34)(H,31,35)

Standard InChI Key:  DKDSJCPQJCMWQO-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   -7.9059    4.8810    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7064    4.8447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9175    6.1205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4182    6.0752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7109    4.7581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4967    3.4783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9960    3.5236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2185    4.6003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2148    5.7150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5268    7.1830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9102    7.7498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1108    9.2364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9237   10.1533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5361    9.5838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3355    8.0973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1555    5.1049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8999    5.5238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9735    4.4763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6807    2.4138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4672    3.2954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.6073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4672    3.2954    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6808    2.4137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4308    1.1147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5720    1.4855    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5875   -0.3771    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1240   -1.8037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1203   -2.9184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7500   -3.5285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7500   -3.5285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1203   -2.9184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1240   -1.8036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5875   -0.3771    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.4307    1.1147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5720    1.4855    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  5  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 10  1  0
  9 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 21 22  1  0
 22  8  1  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 24 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 19  1  0
 34 35  2  0
M  END

Associated Targets(non-human)

Genome polyprotein (55 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 473.62Molecular Weight (Monoisotopic): 473.2678AlogP: 5.48#Rotatable Bonds: 2
Polar Surface Area: 83.36Molecular Species: NEUTRALHBA: 4HBD: 3
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 9.99CX Basic pKa: CX LogP: 4.94CX LogD: 4.94
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.46Np Likeness Score: 0.12

References

1.  (2013)  Macrocyclic indoles as hepatitis C virus inhibitors, 

Source

Source(1):