US8592454, 378

ID: ALA3651895

PubChem CID: 73265456

Max Phase: Preclinical

Molecular Formula: C27H29F7N4O3

Molecular Weight: 590.54

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN(C(=O)N(C)[C@@H]1CN(C(=O)NC2CCOCC2)C[C@H]1c1ccc(F)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1

Standard InChI:  InChI=1S/C27H29F7N4O3/c1-36(21-12-17(26(29,30)31)11-18(13-21)27(32,33)34)25(40)37(2)23-15-38(24(39)35-20-7-9-41-10-8-20)14-22(23)16-3-5-19(28)6-4-16/h3-6,11-13,20,22-23H,7-10,14-15H2,1-2H3,(H,35,39)/t22-,23+/m0/s1

Standard InChI Key:  OUYSLNGQLIIZQC-XZOQPEGZSA-N

Molfile:  

     RDKit          2D

 41 44  0  0  1  0  0  0  0  0999 V2000
    3.3615    1.3842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2567    0.5852    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9511   -0.8815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9531   -1.9978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2010   -3.2956    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.7343   -2.9815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5987   -1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3383    1.3500    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8054   -4.6666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9984   -4.7960    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9195   -5.8781    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.5250   -7.2514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6414   -8.4636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2492   -9.8349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7408   -9.9941    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.6244   -8.7820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0165   -7.4107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6819    1.0557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5772    0.2566    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9880    2.5249    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.0928    3.3240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4132    2.9954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7213    4.4634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1466    4.9307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2640    3.9300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9560    2.4620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5307    1.9947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0740    1.4607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2145    1.8338    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   10.8273    0.2863    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   11.9675    0.6597    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.4548    6.3996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5614    7.2008    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   10.5952    6.7731    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.7017    7.5739    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  1  6
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  3  1  0
  7  8  1  1
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 11 13  1  0
 13 14  2  0
 14  8  1  0
  5 15  1  0
 15 16  2  0
 15 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 18  1  0
  2 24  1  0
 24 25  2  0
 24 26  1  0
 26 27  1  0
 26 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
 32 34  1  0
 34 35  1  0
 34 36  1  0
 34 37  1  0
 30 38  1  0
 38 39  1  0
 38 40  1  0
 38 41  1  0
M  END

Associated Targets(Human)

TACR2 Tchem Neurokinin 2 receptor (3341 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
TACR3 Tchem Neurokinin 3 receptor (1696 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
TACR1 Tclin Neurokinin 1 receptor (6273 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 590.54Molecular Weight (Monoisotopic): 590.2128AlogP: 5.71#Rotatable Bonds: 4
Polar Surface Area: 65.12Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 3.75CX LogD: 3.75
Aromatic Rings: 2Heavy Atoms: 41QED Weighted: 0.46Np Likeness Score: -0.98

References

1.  (2013)  Nitrogen-containing heterocyclic compound and use of same, 

Source

Source(1):