The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(3,6-Dichloro-acridin-9-ylamino)-benzenesulfonamide ID: ALA36532
PubChem CID: 9979401
Max Phase: Preclinical
Molecular Formula: C19H13Cl2N3O2S
Molecular Weight: 418.31
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: NS(=O)(=O)c1ccc(Nc2c3ccc(Cl)cc3nc3cc(Cl)ccc23)cc1
Standard InChI: InChI=1S/C19H13Cl2N3O2S/c20-11-1-7-15-17(9-11)24-18-10-12(21)2-8-16(18)19(15)23-13-3-5-14(6-4-13)27(22,25)26/h1-10H,(H,23,24)(H2,22,25,26)
Standard InChI Key: HPDKFWFFTQAQET-UHFFFAOYSA-N
Molfile:
RDKit 2D
27 30 0 0 0 0 0 0 0 0999 V2000
-2.9122 -1.3658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9134 -2.1927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1990 -2.6054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2008 -0.9533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4858 -1.3622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4850 -2.1885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7701 -2.5993 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7758 -0.9482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0604 -1.3553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0568 -2.1844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6620 -2.5940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3776 -2.1756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3699 -1.3434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6506 -0.9375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7801 -0.1238 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0684 0.2922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6433 -0.1196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3547 0.2957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3507 1.1211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6295 1.5294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0790 1.1116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0946 -2.5827 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-3.6278 -2.6044 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2.0620 1.5381 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.7734 1.9571 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4798 0.8272 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.6433 2.2484 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12 13 1 0
3 6 2 0
13 14 2 0
14 9 1 0
6 7 1 0
8 15 1 0
7 10 2 0
15 16 1 0
1 2 2 0
16 17 2 0
9 8 2 0
17 18 1 0
8 5 1 0
18 19 2 0
5 4 2 0
19 20 1 0
4 1 1 0
20 21 2 0
21 16 1 0
9 10 1 0
12 22 1 0
2 23 1 0
10 11 1 0
19 24 1 0
2 3 1 0
24 25 1 0
11 12 2 0
24 26 2 0
5 6 1 0
24 27 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 418.31Molecular Weight (Monoisotopic): 417.0106AlogP: 5.09#Rotatable Bonds: 3Polar Surface Area: 85.08Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.80CX Basic pKa: 6.93CX LogP: 4.76CX LogD: 4.64Aromatic Rings: 4Heavy Atoms: 27QED Weighted: 0.45Np Likeness Score: -1.19
References 1. Gamage SA, Tepsiri N, Wilairat P, Wojcik SJ, Figgitt DP, Ralph RK, Denny WA.. (1994) Synthesis and in vitro evaluation of 9-anilino-3,6-diaminoacridines active against a multidrug-resistant strain of the malaria parasite Plasmodium falciparum., 37 (10): [PMID:8182707 ] [10.1021/jm00036a014 ] 2. Acharya BN, Saraswat D, Kaushik MP.. (2008) Pharmacophore based discovery of potential antimalarial agent targeting haem detoxification pathway., 43 (12): [PMID:18395298 ] [10.1016/j.ejmech.2008.02.005 ] 3. Prado-Prado FJ, García-Mera X, González-Díaz H.. (2010) Multi-target spectral moment QSAR versus ANN for antiparasitic drugs against different parasite species., 18 (6): [PMID:20185316 ] [10.1016/j.bmc.2010.01.068 ]