US8912221, 29

ID: ALA3657636

PubChem CID: 57382966

Max Phase: Preclinical

Molecular Formula: C25H20ClF2N7O4

Molecular Weight: 555.93

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1nc(-c2c(F)cc(Cl)cc2-c2cnc([C@@H](C)NC(=O)C3(NC(=O)c4cccnn4)COC3)c(F)c2)no1

Standard InChI:  InChI=1S/C25H20ClF2N7O4/c1-12(31-24(37)25(10-38-11-25)33-23(36)19-4-3-5-30-34-19)21-18(28)6-14(9-29-21)16-7-15(26)8-17(27)20(16)22-32-13(2)39-35-22/h3-9,12H,10-11H2,1-2H3,(H,31,37)(H,33,36)/t12-/m1/s1

Standard InChI Key:  LSWDLQVHQFWVKW-GFCCVEGCSA-N

Molfile:  

     RDKit          2D

 39 43  0  0  1  0  0  0  0  0999 V2000
    7.7977   -1.8152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7952   -3.0152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4937   -3.7625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1952   -3.0099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1977   -1.8099    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8937   -3.7572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9522   -4.7267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8892   -5.7850    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8309   -4.7220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5951   -3.0039    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6375   -0.9049    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.0936   -3.7679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3931   -3.0185    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.6918   -3.7690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6912   -5.2690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3919   -6.0185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0932   -5.2680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0537   -5.8676    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   12.9906   -6.0198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9878   -7.5199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2853   -8.2725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2830   -9.4725    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   15.5859   -7.5250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5888   -6.0250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6292   -5.4271    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   14.2912   -5.2725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2942   -3.7717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0838   -2.9075    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.5524   -1.4826    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.0524   -1.4880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7612   -0.5197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5108   -2.9162    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  6
  2  3  1  0
  3  4  1  0
  4  5  2  0
  4  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9  6  1  0
  6 10  1  0
 10 11  1  0
 11 12  2  0
 11 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
  2 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 24 25  1  0
 22 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  1  0
 28 30  2  0
 30 31  1  0
 31 32  1  0
 31 33  2  0
 33 26  1  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
 37 39  2  0
 39 34  1  0
M  END

Associated Targets(Human)

BDKRB1 Tchem Bradykinin B1 receptor (1859 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 555.93Molecular Weight (Monoisotopic): 555.1233AlogP: 3.20#Rotatable Bonds: 7
Polar Surface Area: 145.02Molecular Species: NEUTRALHBA: 9HBD: 2
#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 11.43CX Basic pKa: 1.41CX LogP: 1.85CX LogD: 1.85
Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.35Np Likeness Score: -1.48

References

1.  (2014)  Biaryl amide derivatives, 

Source

Source(1):