US8912221, 31

ID: ALA3657638

PubChem CID: 57383007

Max Phase: Preclinical

Molecular Formula: C27H23ClF2N6O5

Molecular Weight: 584.97

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ncc(C(=O)NC2(C(=O)N[C@H](C)c3ccc(-c4cc(Cl)cc(F)c4-c4noc(C)n4)cc3F)COC2)cn1

Standard InChI:  InChI=1S/C27H23ClF2N6O5/c1-13(33-25(38)27(11-40-12-27)35-24(37)16-9-31-26(39-3)32-10-16)18-5-4-15(6-20(18)29)19-7-17(28)8-21(30)22(19)23-34-14(2)41-36-23/h4-10,13H,11-12H2,1-3H3,(H,33,38)(H,35,37)/t13-/m1/s1

Standard InChI Key:  VISBFCYEAMWAIG-CYBMUJFWSA-N

Molfile:  

     RDKit          2D

 41 45  0  0  1  0  0  0  0  0999 V2000
    2.5956   -2.7031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6003    1.4977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6024    2.6977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8990    0.7455    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2007    1.4934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2632    2.4586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2045    3.5212    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1419    2.4626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4991    0.7407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4966   -0.4593    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8006    1.4880    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0991    0.7354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0966   -0.4646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.4006    1.4827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.4012    2.9828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.7005    3.7323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.9993    2.9819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.9988    1.4819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.6995    0.7323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.6991   -0.4677    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  -14.2992    3.7318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -15.5969    2.9793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -16.8974    3.7268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -17.9355    3.1248    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  -16.9003    5.2268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -15.6027    5.9793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -15.6050    7.1793    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  -14.3022    5.2318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -13.0040    5.9848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.6504    5.3685    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  -10.6507    6.4868    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -11.4052    7.7831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.9210    8.8811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.8713    7.4661    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  3  1  0
  6  9  1  0
  9 10  2  0
  9 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 12  1  0
 12 16  1  0
 16 17  2  0
 16 18  1  0
 18 19  1  0
 19 20  1  6
 19 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 26 27  1  0
 24 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  1  0
 30 32  2  0
 32 33  1  0
 33 34  1  0
 33 35  2  0
 35 28  1  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  1  0
 39 40  1  0
 39 41  2  0
 41 36  1  0
M  END

Associated Targets(Human)

BDKRB1 Tchem Bradykinin B1 receptor (1859 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 584.97Molecular Weight (Monoisotopic): 584.1387AlogP: 3.82#Rotatable Bonds: 8
Polar Surface Area: 141.36Molecular Species: NEUTRALHBA: 9HBD: 2
#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 12.04CX Basic pKa: 0.35CX LogP: 3.25CX LogD: 3.25
Aromatic Rings: 4Heavy Atoms: 41QED Weighted: 0.32Np Likeness Score: -1.46

References

1.  (2014)  Biaryl amide derivatives, 

Source

Source(1):