The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8912221, 32 ID: ALA3657639
PubChem CID: 57383008
Max Phase: Preclinical
Molecular Formula: C24H20Cl2F3N3O5
Molecular Weight: 558.34
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C[C@@H](NC(=O)C1(NC(=O)c2ccno2)COC1)c1ccc(-c2cc(Cl)cc(Cl)c2OCC(F)F)cc1F
Standard InChI: InChI=1S/C24H20Cl2F3N3O5/c1-12(31-23(34)24(10-35-11-24)32-22(33)19-4-5-30-37-19)15-3-2-13(6-18(15)27)16-7-14(25)8-17(26)21(16)36-9-20(28)29/h2-8,12,20H,9-11H2,1H3,(H,31,34)(H,32,33)/t12-/m1/s1
Standard InChI Key: TVIHSGNVGMFCOO-GFCCVEGCSA-N
Molfile:
RDKit 2D
37 40 0 0 1 0 0 0 0 0999 V2000
3.6380 -0.8969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5998 -1.4987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6028 -2.9995 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9036 -3.7481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9418 -3.1464 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9065 -5.2490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5378 -4.8165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1522 -6.2661 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6018 -6.6517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2079 -5.9974 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5069 -5.2457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5053 -4.0457 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8079 -5.9939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1595 -5.3734 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1628 -6.4885 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.4123 -7.7873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9452 -7.4748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -2.7000 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.5987 1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8967 0.7484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1969 1.4963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2352 0.8946 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-5.1993 2.9963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9014 3.7484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9034 4.9484 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-2.6012 3.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3011 3.7503 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0012 3.0001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2988 3.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3382 3.1502 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 4.9500 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 1
2 3 1 0
3 4 1 0
4 5 2 0
4 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 6 1 0
6 10 1 0
10 11 1 0
11 12 2 0
11 13 1 0
13 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 13 2 0
2 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
23 24 1 0
21 25 1 0
25 26 2 0
26 27 1 0
27 28 1 0
27 29 2 0
29 30 1 0
30 31 1 0
30 32 2 0
32 25 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
35 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 558.34Molecular Weight (Monoisotopic): 557.0732AlogP: 4.81#Rotatable Bonds: 9Polar Surface Area: 102.69Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.51CX Basic pKa: ┄CX LogP: 3.74CX LogD: 3.74Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.39Np Likeness Score: -1.40
References 1. (2014) Biaryl amide derivatives,