The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8912221, 33 ID: ALA3657640
PubChem CID: 57383009
Max Phase: Preclinical
Molecular Formula: C22H18Cl2F6N2O4
Molecular Weight: 559.29
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C[C@@H](NC(=O)C1(NC(=O)C(F)(F)F)COC1)c1ccc(-c2cc(Cl)cc(Cl)c2OCC(F)F)cc1F
Standard InChI: InChI=1S/C22H18Cl2F6N2O4/c1-10(31-19(33)21(8-35-9-21)32-20(34)22(28,29)30)13-3-2-11(4-16(13)25)14-5-12(23)6-15(24)18(14)36-7-17(26)27/h2-6,10,17H,7-9H2,1H3,(H,31,33)(H,32,34)/t10-/m1/s1
Standard InChI Key: MWQLTYPGCVGPCZ-SNVBAGLBSA-N
Molfile:
RDKit 2D
36 38 0 0 1 0 0 0 0 0999 V2000
3.6380 -0.8969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5998 -1.4987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6028 -2.9995 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9036 -3.7481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9418 -3.1464 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9065 -5.2490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5378 -4.8165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1522 -6.2661 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6018 -6.6517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2079 -5.9974 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5069 -5.2457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5053 -4.0457 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8079 -5.9939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8465 -5.3928 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.8095 -7.1939 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.8478 -6.5927 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -2.7000 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.5987 1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8967 0.7484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1969 1.4963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2352 0.8946 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-5.1993 2.9963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9014 3.7484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9034 4.9484 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-2.6012 3.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3011 3.7503 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0012 3.0001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2988 3.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3382 3.1502 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 4.9500 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 1
2 3 1 0
3 4 1 0
4 5 2 0
4 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 6 1 0
6 10 1 0
10 11 1 0
11 12 2 0
11 13 1 0
13 14 1 0
13 15 1 0
13 16 1 0
2 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
22 23 1 0
20 24 1 0
24 25 2 0
25 26 1 0
26 27 1 0
26 28 2 0
28 29 1 0
29 30 1 0
29 31 2 0
31 24 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
34 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 559.29Molecular Weight (Monoisotopic): 558.0548AlogP: 5.07#Rotatable Bonds: 8Polar Surface Area: 76.66Molecular Species: ACIDHBA: 4HBD: 2#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 6.18CX Basic pKa: ┄CX LogP: 4.74CX LogD: 3.95Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.44Np Likeness Score: -1.05
References 1. (2014) Biaryl amide derivatives,