US8912221, 33

ID: ALA3657640

PubChem CID: 57383009

Max Phase: Preclinical

Molecular Formula: C22H18Cl2F6N2O4

Molecular Weight: 559.29

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[C@@H](NC(=O)C1(NC(=O)C(F)(F)F)COC1)c1ccc(-c2cc(Cl)cc(Cl)c2OCC(F)F)cc1F

Standard InChI:  InChI=1S/C22H18Cl2F6N2O4/c1-10(31-19(33)21(8-35-9-21)32-20(34)22(28,29)30)13-3-2-11(4-16(13)25)14-5-12(23)6-15(24)18(14)36-7-17(26)27/h2-6,10,17H,7-9H2,1H3,(H,31,33)(H,32,34)/t10-/m1/s1

Standard InChI Key:  MWQLTYPGCVGPCZ-SNVBAGLBSA-N

Molfile:  

     RDKit          2D

 36 38  0  0  1  0  0  0  0  0999 V2000
    3.6380   -0.8969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5998   -1.4987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6028   -2.9995    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9036   -3.7481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9418   -3.1464    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9065   -5.2490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5378   -4.8165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1522   -6.2661    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6018   -6.6517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2079   -5.9974    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5069   -5.2457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5053   -4.0457    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.8079   -5.9939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8465   -5.3928    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.8095   -7.1939    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    8.8478   -6.5927    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -2.7000    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5987    1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8967    0.7484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1969    1.4963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2352    0.8946    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -5.1993    2.9963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9014    3.7484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9034    4.9484    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -2.6012    3.0004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3011    3.7503    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0012    3.0001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2988    3.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3382    3.1502    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    4.9500    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  1
  2  3  1  0
  3  4  1  0
  4  5  2  0
  4  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9  6  1  0
  6 10  1  0
 10 11  1  0
 11 12  2  0
 11 13  1  0
 13 14  1  0
 13 15  1  0
 13 16  1  0
  2 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 22 23  1  0
 20 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  1  0
 26 28  2  0
 28 29  1  0
 29 30  1  0
 29 31  2  0
 31 24  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 34 36  1  0
M  END

Associated Targets(Human)

BDKRB1 Tchem Bradykinin B1 receptor (1859 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 559.29Molecular Weight (Monoisotopic): 558.0548AlogP: 5.07#Rotatable Bonds: 8
Polar Surface Area: 76.66Molecular Species: ACIDHBA: 4HBD: 2
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 6.18CX Basic pKa: CX LogP: 4.74CX LogD: 3.95
Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.44Np Likeness Score: -1.05

References

1.  (2014)  Biaryl amide derivatives, 

Source

Source(1):