US8912221, 39

ID: ALA3657646

PubChem CID: 57383056

Max Phase: Preclinical

Molecular Formula: C23H20Cl2F3N5O5

Molecular Weight: 574.34

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1nnc(C(=O)NC2(C(=O)N[C@H](C)c3ncc(-c4cc(Cl)cc(Cl)c4OCC(F)F)cc3F)COC2)o1

Standard InChI:  InChI=1S/C23H20Cl2F3N5O5/c1-10(30-22(35)23(8-36-9-23)31-20(34)21-33-32-11(2)38-21)18-16(26)3-12(6-29-18)14-4-13(24)5-15(25)19(14)37-7-17(27)28/h3-6,10,17H,7-9H2,1-2H3,(H,30,35)(H,31,34)/t10-/m1/s1

Standard InChI Key:  MXBKUQQIAJRWAI-SNVBAGLBSA-N

Molfile:  

     RDKit          2D

 38 41  0  0  1  0  0  0  0  0999 V2000
    3.6380   -0.8969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5998   -1.4987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6028   -2.9995    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9036   -3.7481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9418   -3.1464    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9065   -5.2490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5378   -4.8165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1522   -6.2661    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6018   -6.6517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2079   -5.9974    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5069   -5.2457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5053   -4.0457    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.8079   -5.9939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1595   -5.3734    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1628   -6.4885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3562   -6.3635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4123   -7.7873    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.9452   -7.4748    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -2.7000    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5987    1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8967    0.7484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1969    1.4963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2352    0.8946    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -5.1993    2.9963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9014    3.7484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9034    4.9484    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -2.6012    3.0004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3011    3.7503    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0012    3.0001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2988    3.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3382    3.1502    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    4.9500    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  1
  2  3  1  0
  3  4  1  0
  4  5  2  0
  4  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9  6  1  0
  6 10  1  0
 10 11  1  0
 11 12  2  0
 11 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 15 17  2  0
 17 18  1  0
 18 13  2  0
  2 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 24 25  1  0
 22 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  1  0
 28 30  2  0
 30 31  1  0
 31 32  1  0
 31 33  2  0
 33 26  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
 36 38  1  0
M  END

Associated Targets(Human)

BDKRB1 Tchem Bradykinin B1 receptor (1859 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 574.34Molecular Weight (Monoisotopic): 573.0794AlogP: 3.91#Rotatable Bonds: 9
Polar Surface Area: 128.47Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.39CX Basic pKa: 1.10CX LogP: 1.96CX LogD: 1.96
Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.39Np Likeness Score: -1.17

References

1.  (2014)  Biaryl amide derivatives, 

Source

Source(1):