The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8912221, 42 ID: ALA3657649
PubChem CID: 57383097
Max Phase: Preclinical
Molecular Formula: C22H22Cl2F3N3O5
Molecular Weight: 536.33
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COCC(=O)NC1(C(=O)N[C@H](C)c2ncc(-c3cc(Cl)cc(Cl)c3OCC(F)F)cc2F)COC1
Standard InChI: InChI=1S/C22H22Cl2F3N3O5/c1-11(29-21(32)22(9-34-10-22)30-18(31)8-33-2)19-16(25)3-12(6-28-19)14-4-13(23)5-15(24)20(14)35-7-17(26)27/h3-6,11,17H,7-10H2,1-2H3,(H,29,32)(H,30,31)/t11-/m1/s1
Standard InChI Key: ZYTIZDWKWBIHRN-LLVKDONJSA-N
Molfile:
RDKit 2D
35 37 0 0 1 0 0 0 0 0999 V2000
12.7396 -1.3315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6993 -0.7333 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.4004 -1.4852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0993 -0.7370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0976 0.4630 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8004 -1.4889 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4993 -0.7407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4372 0.2248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4961 1.2871 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5585 0.2281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2003 -1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2024 -2.6932 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 -0.7455 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6024 -2.6977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -2.7000 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.5987 1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8967 0.7484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1969 1.4963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2352 0.8946 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-5.1993 2.9963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9014 3.7484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9034 4.9484 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-2.6012 3.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3011 3.7503 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0012 3.0001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2988 3.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3382 3.1502 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 4.9500 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 2 0
4 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 7 1 0
7 11 1 0
11 12 2 0
11 13 1 0
13 14 1 0
14 15 1 6
14 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
21 22 1 0
19 23 1 0
23 24 2 0
24 25 1 0
25 26 1 0
25 27 2 0
27 28 1 0
28 29 1 0
28 30 2 0
30 23 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
33 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 536.33Molecular Weight (Monoisotopic): 535.0889AlogP: 3.55#Rotatable Bonds: 10Polar Surface Area: 98.78Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.03CX Basic pKa: 1.10CX LogP: 2.45CX LogD: 2.45Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.48Np Likeness Score: -1.11
References 1. (2014) Biaryl amide derivatives,