US8912221, 43

ID: ALA3657650

PubChem CID: 57383098

Max Phase: Preclinical

Molecular Formula: C25H22ClF2N7O5

Molecular Weight: 573.94

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(C(=O)NC2(C(=O)N[C@H](C)c3ccc(-c4cc(Cl)cc(F)c4-c4nnn(C)n4)cc3F)COC2)on1

Standard InChI:  InChI=1S/C25H22ClF2N7O5/c1-12(29-24(37)25(10-39-11-25)30-23(36)19-9-20(38-3)33-40-19)15-5-4-13(6-17(15)27)16-7-14(26)8-18(28)21(16)22-31-34-35(2)32-22/h4-9,12H,10-11H2,1-3H3,(H,29,37)(H,30,36)/t12-/m1/s1

Standard InChI Key:  DDBPJLLSDPDUAU-GFCCVEGCSA-N

Molfile:  

     RDKit          2D

 40 44  0  0  1  0  0  0  0  0999 V2000
   14.9494   -2.7990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2457   -1.8269    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.7553   -1.9800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7520   -0.8650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4004   -1.4856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5378   -2.9665    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.0049   -3.2788    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.0993   -0.7374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0976    0.4626    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.8004   -1.4893    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4990   -0.7409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4368    0.2246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4958    1.2869    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5581    0.2279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2003   -1.4932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2024   -2.6932    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8990   -0.7455    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6003   -1.4977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6024   -2.6977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -2.7000    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5987    1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8967    0.7484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1969    1.4963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2352    0.8946    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -5.1993    2.9963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9014    3.7484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9034    4.9484    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6012    3.0004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3027    3.7529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0506    3.1362    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0508    4.2541    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.2966    5.5507    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7812    6.6485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1696    5.2342    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  1  0
  7  3  2  0
  5  8  1  0
  8  9  2  0
  8 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 11  1  0
 11 15  1  0
 15 16  2  0
 15 17  1  0
 17 18  1  0
 18 19  1  6
 18 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 25 26  1  0
 23 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  1  0
 29 31  2  0
 31 32  1  0
 32 33  1  0
 32 34  2  0
 34 27  1  0
 34 35  1  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  1  0
 38 40  1  0
 40 35  2  0
M  END

Associated Targets(Human)

BDKRB1 Tchem Bradykinin B1 receptor (1859 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 573.94Molecular Weight (Monoisotopic): 573.1339AlogP: 2.85#Rotatable Bonds: 8
Polar Surface Area: 146.29Molecular Species: NEUTRALHBA: 10HBD: 2
#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 11.24CX Basic pKa: CX LogP: 3.39CX LogD: 3.39
Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.32Np Likeness Score: -1.54

References

1.  (2014)  Biaryl amide derivatives, 

Source

Source(1):