The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8912224, 134 ID: ALA3657777
PubChem CID: 71292961
Max Phase: Preclinical
Molecular Formula: C25H23N3O2S
Molecular Weight: 429.55
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: c1ccc(C2CCc3cc(Oc4ncc(CNCc5ccncc5)s4)ccc3O2)cc1
Standard InChI: InChI=1S/C25H23N3O2S/c1-2-4-19(5-3-1)23-8-6-20-14-21(7-9-24(20)30-23)29-25-28-17-22(31-25)16-27-15-18-10-12-26-13-11-18/h1-5,7,9-14,17,23,27H,6,8,15-16H2
Standard InChI Key: HYQZOWKBOUKHIQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 35 0 0 0 0 0 0 0 0999 V2000
-1.4309 -7.5400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5420 -6.3307 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.9498 -6.4949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8372 -5.2877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3372 -5.2929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8056 -3.8679 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1968 1.5003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1993 3.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4995 3.7483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7974 2.9963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7950 1.4963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4948 0.7483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3786 -3.8595 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-2.9227 -7.3758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8129 -8.5831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3036 -8.4159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.9041 -7.0414 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.0140 -5.8340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5234 -6.0012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 12 1 0
17 18 2 0
18 9 1 0
14 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
7 25 1 0
25 4 1 0
1 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 429.55Molecular Weight (Monoisotopic): 429.1511AlogP: 5.69#Rotatable Bonds: 7Polar Surface Area: 56.27Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 7.29CX LogP: 5.13CX LogD: 4.88Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.41Np Likeness Score: -0.52
References 1. (2014) Substituted 2-(chroman-6-yloxy)-thiazoles and their use as pharmaceuticals,