US9040518, 64

ID: ALA3658910

PubChem CID: 67466960

Max Phase: Preclinical

Molecular Formula: C30H42N2O7S

Molecular Weight: 574.74

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCC1(CCCC)CS(=O)(=O)c2cc(CNC(CC(=O)O)CC(=O)O)c(OC)cc2C(c2ccccc2)N1

Standard InChI:  InChI=1S/C30H42N2O7S/c1-4-6-13-30(14-7-5-2)20-40(37,38)26-15-22(19-31-23(16-27(33)34)17-28(35)36)25(39-3)18-24(26)29(32-30)21-11-9-8-10-12-21/h8-12,15,18,23,29,31-32H,4-7,13-14,16-17,19-20H2,1-3H3,(H,33,34)(H,35,36)

Standard InChI Key:  NWQMRLFYJYLMGL-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 40 42  0  0  0  0  0  0  0  0999 V2000
    2.8801    4.4091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2333    3.2622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2127    2.1618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6544    0.7275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6852   -0.3846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0761   -1.8075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5391   -2.1425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9813   -3.5767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1510   -3.8446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3514    1.0778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.7286    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0569    2.2970    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0568    2.2971    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3515    1.0777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4523    2.0983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8856    1.6561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9837    2.6792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6477    4.1419    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7458    5.1650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4097    6.6277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5078    7.6508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2391    8.8203    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.6551    7.2991    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1816    4.7281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.2785    5.7524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.4266    5.4030    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -8.0075    6.9213    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2194    0.1937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6526   -0.2516    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9180   -1.4219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1198   -0.8265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6852   -0.3847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7500   -1.5574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7500   -1.5574    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4011   -2.9095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9046   -2.9463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6237   -4.2627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8432   -5.5436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3436   -5.5082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6245   -4.1918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  5 10  1  0
 10 11  1  0
 11 12  2  0
 11 13  2  0
 11 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 21 23  1  0
 19 24  1  0
 24 25  1  0
 25 26  2  0
 25 27  1  0
 16 28  2  0
 28 29  1  0
 29 30  1  0
 28 31  1  0
 31 32  2  0
 32 14  1  0
 32 33  1  0
 33 34  1  0
 34  5  1  0
 33 35  1  0
 35 36  2  0
 36 37  1  0
 37 38  2  0
 38 39  1  0
 39 40  2  0
 40 35  1  0
M  END

Associated Targets(Human)

SLC10A2 Tclin Ileal bile acid transporter (415 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 574.74Molecular Weight (Monoisotopic): 574.2713AlogP: 4.69#Rotatable Bonds: 15
Polar Surface Area: 142.03Molecular Species: ACIDHBA: 7HBD: 4
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 2.02CX Basic pKa: 8.41CX LogP: 0.12CX LogD: -1.45
Aromatic Rings: 2Heavy Atoms: 40QED Weighted: 0.24Np Likeness Score: -0.08

References

1.  (2015)  Chemical compounds, 

Source

Source(1):