The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9040518, 65 ID: ALA3658911
PubChem CID: 67466861
Max Phase: Preclinical
Molecular Formula: C27H38N2O5S
Molecular Weight: 502.68
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCCC1(CCCC)CS(=O)(=O)c2cc(CNCC(=O)O)c(OC)cc2C(c2ccccc2)N1
Standard InChI: InChI=1S/C27H38N2O5S/c1-4-6-13-27(14-7-5-2)19-35(32,33)24-15-21(17-28-18-25(30)31)23(34-3)16-22(24)26(29-27)20-11-9-8-10-12-20/h8-12,15-16,26,28-29H,4-7,13-14,17-19H2,1-3H3,(H,30,31)
Standard InChI Key: KBZOLELTOAPIRR-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 37 0 0 0 0 0 0 0 0999 V2000
2.8801 4.4091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2333 3.2622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2127 2.1618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6544 0.7275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6852 -0.3846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0761 -1.8075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5391 -2.1425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9813 -3.5767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1510 -3.8446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3514 1.0778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.7286 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-1.0569 2.2970 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0568 2.2971 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3515 1.0777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4523 2.0983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8856 1.6561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9837 2.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6477 4.1419 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.7458 5.1650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4097 6.6277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2877 7.4457 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.2624 6.9794 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.2194 0.1937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.6526 -0.2516 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.9180 -1.4219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1198 -0.8265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6852 -0.3847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7500 -1.5574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7500 -1.5574 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.4011 -2.9095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9046 -2.9463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6237 -4.2627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8432 -5.5436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3436 -5.5082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6245 -4.1918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
5 10 1 0
10 11 1 0
11 12 2 0
11 13 2 0
11 14 1 0
14 15 2 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 2 0
20 22 1 0
16 23 2 0
23 24 1 0
24 25 1 0
23 26 1 0
26 27 2 0
27 14 1 0
27 28 1 0
28 29 1 0
29 5 1 0
28 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 502.68Molecular Weight (Monoisotopic): 502.2501AlogP: 4.45#Rotatable Bonds: 12Polar Surface Area: 104.73Molecular Species: ACIDHBA: 6HBD: 3#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 0.73CX Basic pKa: 8.26CX LogP: 2.04CX LogD: 2.01Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.39Np Likeness Score: -0.19
References 1. (2015) Chemical compounds,