US9040518, 65

ID: ALA3658911

PubChem CID: 67466861

Max Phase: Preclinical

Molecular Formula: C27H38N2O5S

Molecular Weight: 502.68

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCC1(CCCC)CS(=O)(=O)c2cc(CNCC(=O)O)c(OC)cc2C(c2ccccc2)N1

Standard InChI:  InChI=1S/C27H38N2O5S/c1-4-6-13-27(14-7-5-2)19-35(32,33)24-15-21(17-28-18-25(30)31)23(34-3)16-22(24)26(29-27)20-11-9-8-10-12-20/h8-12,15-16,26,28-29H,4-7,13-14,17-19H2,1-3H3,(H,30,31)

Standard InChI Key:  KBZOLELTOAPIRR-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 37  0  0  0  0  0  0  0  0999 V2000
    2.8801    4.4091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2333    3.2622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2127    2.1618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6544    0.7275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6852   -0.3846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0761   -1.8075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5391   -2.1425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9813   -3.5767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1510   -3.8446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3514    1.0778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.7286    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0569    2.2970    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0568    2.2971    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3515    1.0777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4523    2.0983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8856    1.6561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9837    2.6792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6477    4.1419    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7458    5.1650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4097    6.6277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2877    7.4457    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2624    6.9794    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2194    0.1937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6526   -0.2516    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9180   -1.4219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1198   -0.8265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6852   -0.3847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7500   -1.5574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7500   -1.5574    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4011   -2.9095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9046   -2.9463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6237   -4.2627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8432   -5.5436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3436   -5.5082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6245   -4.1918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  5 10  1  0
 10 11  1  0
 11 12  2  0
 11 13  2  0
 11 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 20 22  1  0
 16 23  2  0
 23 24  1  0
 24 25  1  0
 23 26  1  0
 26 27  2  0
 27 14  1  0
 27 28  1  0
 28 29  1  0
 29  5  1  0
 28 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
M  END

Associated Targets(Human)

SLC10A2 Tclin Ileal bile acid transporter (415 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 502.68Molecular Weight (Monoisotopic): 502.2501AlogP: 4.45#Rotatable Bonds: 12
Polar Surface Area: 104.73Molecular Species: ACIDHBA: 6HBD: 3
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 0.73CX Basic pKa: 8.26CX LogP: 2.04CX LogD: 2.01
Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.39Np Likeness Score: -0.19

References

1.  (2015)  Chemical compounds, 

Source

Source(1):