The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9040518, 66 ID: ALA3658912
PubChem CID: 68207834
Max Phase: Preclinical
Molecular Formula: C25H36NO6PS
Molecular Weight: 509.61
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCCC1(CCCC)CS(=O)(=O)c2cc(CP(=O)(O)O)c(OC)cc2C(c2ccccc2)N1
Standard InChI: InChI=1S/C25H36NO6PS/c1-4-6-13-25(14-7-5-2)18-34(30,31)23-15-20(17-33(27,28)29)22(32-3)16-21(23)24(26-25)19-11-9-8-10-12-19/h8-12,15-16,24,26H,4-7,13-14,17-18H2,1-3H3,(H2,27,28,29)
Standard InChI Key: PGZJWCFWLZZHIJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
2.8801 4.4091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2333 3.2622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2127 2.1618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6544 0.7275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6852 -0.3846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0761 -1.8075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5391 -2.1425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9813 -3.5767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1510 -3.8446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3514 1.0778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.7286 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-1.0569 2.2970 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0568 2.2971 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3515 1.0777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4523 2.0983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8856 1.6561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9837 2.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6477 4.1419 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
-5.5257 4.9599 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.5004 4.4937 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.3784 5.3113 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.2194 0.1937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.6526 -0.2516 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.9180 -1.4219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1198 -0.8265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6852 -0.3847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7500 -1.5574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7500 -1.5574 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.4011 -2.9095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9046 -2.9463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6237 -4.2627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8432 -5.5436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3436 -5.5082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6245 -4.1918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
5 10 1 0
10 11 1 0
11 12 2 0
11 13 2 0
11 14 1 0
14 15 2 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 2 0
18 20 1 0
18 21 1 0
16 22 2 0
22 23 1 0
23 24 1 0
22 25 1 0
25 26 2 0
26 14 1 0
26 27 1 0
27 28 1 0
28 5 1 0
27 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 509.61Molecular Weight (Monoisotopic): 509.2001AlogP: 4.96#Rotatable Bonds: 10Polar Surface Area: 112.93Molecular Species: ACIDHBA: 5HBD: 3#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 1.72CX Basic pKa: 4.71CX LogP: 2.39CX LogD: 1.33Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.39Np Likeness Score: 0.02
References 1. (2015) Chemical compounds,