US9040518, 67

ID: ALA3658913

PubChem CID: 67463775

Max Phase: Preclinical

Molecular Formula: C26H37N3O4S

Molecular Weight: 487.67

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCC[C@]1(CC)CS(=O)(=O)c2cc(CNCC(=O)O)c(N(C)C)cc2[C@@H](c2ccccc2)N1

Standard InChI:  InChI=1S/C26H37N3O4S/c1-5-7-13-26(6-2)18-34(32,33)23-14-20(16-27-17-24(30)31)22(29(3)4)15-21(23)25(28-26)19-11-9-8-10-12-19/h8-12,14-15,25,27-28H,5-7,13,16-18H2,1-4H3,(H,30,31)/t25-,26-/m1/s1

Standard InChI Key:  GTLWRUXMAFQIQC-CLJLJLNGSA-N

Molfile:  

     RDKit          2D

 34 36  0  0  1  0  0  0  0  0999 V2000
    0.6819   -5.2220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4977   -4.3420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0556   -2.9078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0759   -1.8072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6852   -0.3846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6548    0.7277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8249    0.4615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3514    1.0778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.7286    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0569    2.2970    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0568    2.2971    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3515    1.0777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4523    2.0983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8856    1.6561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9837    2.6792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6477    4.1419    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7458    5.1650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4097    6.6277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2877    7.4457    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2624    6.9794    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2194    0.1937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1198   -0.8265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6852   -0.3847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7500   -1.5574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7500   -1.5574    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4011   -2.9095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4925   -4.1079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0733   -5.4909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5615   -5.6793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4687   -4.4848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8879   -3.1018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6526   -0.2516    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9180   -1.4219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5337    0.5631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  5  4  1  1
  5  6  1  0
  6  7  1  0
  5  8  1  0
  8  9  1  0
  9 10  2  0
  9 11  2  0
  9 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 18 20  1  0
 14 21  2  0
 21 22  1  0
 22 23  2  0
 23 12  1  0
 23 24  1  0
 24 25  1  0
 25  5  1  0
 24 26  1  6
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 21 32  1  0
 32 33  1  0
 32 34  1  0
M  END

Associated Targets(Human)

SLC10A2 Tclin Ileal bile acid transporter (415 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 487.67Molecular Weight (Monoisotopic): 487.2505AlogP: 3.73#Rotatable Bonds: 10
Polar Surface Area: 98.74Molecular Species: ZWITTERIONHBA: 6HBD: 3
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 1.10CX Basic pKa: 8.57CX LogP: 1.43CX LogD: 1.41
Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.47Np Likeness Score: -0.32

References

1.  (2015)  Chemical compounds, 

Source

Source(1):