The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9040518, 67 ID: ALA3658913
PubChem CID: 67463775
Max Phase: Preclinical
Molecular Formula: C26H37N3O4S
Molecular Weight: 487.67
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCC[C@]1(CC)CS(=O)(=O)c2cc(CNCC(=O)O)c(N(C)C)cc2[C@@H](c2ccccc2)N1
Standard InChI: InChI=1S/C26H37N3O4S/c1-5-7-13-26(6-2)18-34(32,33)23-14-20(16-27-17-24(30)31)22(29(3)4)15-21(23)25(28-26)19-11-9-8-10-12-19/h8-12,14-15,25,27-28H,5-7,13,16-18H2,1-4H3,(H,30,31)/t25-,26-/m1/s1
Standard InChI Key: GTLWRUXMAFQIQC-CLJLJLNGSA-N
Molfile:
RDKit 2D
34 36 0 0 1 0 0 0 0 0999 V2000
0.6819 -5.2220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4977 -4.3420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0556 -2.9078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0759 -1.8072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6852 -0.3846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6548 0.7277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8249 0.4615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3514 1.0778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.7286 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-1.0569 2.2970 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0568 2.2971 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3515 1.0777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4523 2.0983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8856 1.6561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9837 2.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6477 4.1419 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.7458 5.1650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4097 6.6277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2877 7.4457 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.2624 6.9794 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.2194 0.1937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1198 -0.8265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6852 -0.3847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7500 -1.5574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7500 -1.5574 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.4011 -2.9095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4925 -4.1079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0733 -5.4909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5615 -5.6793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4687 -4.4848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8879 -3.1018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.6526 -0.2516 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.9180 -1.4219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5337 0.5631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
5 4 1 1
5 6 1 0
6 7 1 0
5 8 1 0
8 9 1 0
9 10 2 0
9 11 2 0
9 12 1 0
12 13 2 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 2 0
18 20 1 0
14 21 2 0
21 22 1 0
22 23 2 0
23 12 1 0
23 24 1 0
24 25 1 0
25 5 1 0
24 26 1 6
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
21 32 1 0
32 33 1 0
32 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 487.67Molecular Weight (Monoisotopic): 487.2505AlogP: 3.73#Rotatable Bonds: 10Polar Surface Area: 98.74Molecular Species: ZWITTERIONHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 1.10CX Basic pKa: 8.57CX LogP: 1.43CX LogD: 1.41Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.47Np Likeness Score: -0.32
References 1. (2015) Chemical compounds,