US9040518, 69

ID: ALA3658915

PubChem CID: 89398103

Max Phase: Preclinical

Molecular Formula: C28H36N2O8S

Molecular Weight: 560.67

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCC[C@]1(CC)CS(=O)(=O)c2cc(C(=O)NC(COC=O)COC=O)c(OC)cc2[C@@H](c2ccccc2)N1

Standard InChI:  InChI=1S/C28H36N2O8S/c1-4-6-12-28(5-2)17-39(34,35)25-14-22(27(33)29-21(15-37-18-31)16-38-19-32)24(36-3)13-23(25)26(30-28)20-10-8-7-9-11-20/h7-11,13-14,18-19,21,26,30H,4-6,12,15-17H2,1-3H3,(H,29,33)/t26-,28-/m1/s1

Standard InChI Key:  HVQTVAWGMJXGIM-IXCJQBJRSA-N

Molfile:  

     RDKit          2D

 39 41  0  0  1  0  0  0  0  0999 V2000
    0.6819   -5.2220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4977   -4.3420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0556   -2.9078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0759   -1.8072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6852   -0.3846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6548    0.7277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8249    0.4615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3514    1.0778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.7286    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0569    2.2970    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0568    2.2971    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3515    1.0777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4523    2.0983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8856    1.6561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9837    2.6792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1310    2.3275    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6477    4.1419    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7458    5.1650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4097    6.6277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5078    7.6508    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1718    9.1135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0498    9.9315    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1816    4.7281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.2785    5.7524    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -9.7144    5.3154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.5914    6.1344    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2194    0.1937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6526   -0.2516    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9180   -1.4219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1198   -0.8265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6852   -0.3847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7500   -1.5574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7500   -1.5574    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4011   -2.9095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4925   -4.1079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0733   -5.4909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5615   -5.6793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4687   -4.4848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8879   -3.1018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  5  4  1  1
  5  6  1  0
  6  7  1  0
  5  8  1  0
  8  9  1  0
  9 10  2  0
  9 11  2  0
  9 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 15 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 18 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  2  0
 14 27  2  0
 27 28  1  0
 28 29  1  0
 27 30  1  0
 30 31  2  0
 31 12  1  0
 31 32  1  0
 32 33  1  0
 33  5  1  0
 32 34  1  6
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 34  1  0
M  END

Associated Targets(Human)

SLC10A2 Tclin Ileal bile acid transporter (415 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 560.67Molecular Weight (Monoisotopic): 560.2192AlogP: 2.94#Rotatable Bonds: 14
Polar Surface Area: 137.10Molecular Species: NEUTRALHBA: 9HBD: 2
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.22CX Basic pKa: 4.52CX LogP: 3.15CX LogD: 3.15
Aromatic Rings: 2Heavy Atoms: 39QED Weighted: 0.33Np Likeness Score: -0.05

References

1.  (2015)  Chemical compounds, 

Source

Source(1):