The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9040518, 71 ID: ALA3658916
PubChem CID: 71241849
Max Phase: Preclinical
Molecular Formula: C25H35NO3S
Molecular Weight: 429.63
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCC[C@]1(CC)CS(=O)(=O)c2cc(C(C)C)c(OC)cc2[C@@H](c2ccccc2)N1
Standard InChI: InChI=1S/C25H35NO3S/c1-6-8-14-25(7-2)17-30(27,28)23-16-20(18(3)4)22(29-5)15-21(23)24(26-25)19-12-10-9-11-13-19/h9-13,15-16,18,24,26H,6-8,14,17H2,1-5H3/t24-,25-/m1/s1
Standard InChI Key: WKUOZZUYJRHUJA-JWQCQUIFSA-N
Molfile:
RDKit 2D
30 32 0 0 1 0 0 0 0 0999 V2000
0.6819 -5.2220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4977 -4.3420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0556 -2.9078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0759 -1.8072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6852 -0.3846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6548 0.7277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8249 0.4615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3514 1.0778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.7286 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-1.0569 2.2970 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0568 2.2971 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3515 1.0777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4523 2.0983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8856 1.6561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9837 2.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7150 3.8487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1310 2.3275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2194 0.1937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.6526 -0.2516 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.9180 -1.4219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1198 -0.8265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6852 -0.3847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7500 -1.5574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7500 -1.5574 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.4011 -2.9095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4925 -4.1079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0733 -5.4909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5615 -5.6793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4687 -4.4848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8879 -3.1018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
5 4 1 1
5 6 1 0
6 7 1 0
5 8 1 0
8 9 1 0
9 10 2 0
9 11 2 0
9 12 1 0
12 13 2 0
13 14 1 0
14 15 1 0
15 16 1 0
15 17 1 0
14 18 2 0
18 19 1 0
19 20 1 0
18 21 1 0
21 22 2 0
22 12 1 0
22 23 1 0
23 24 1 0
24 5 1 0
23 25 1 6
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 429.63Molecular Weight (Monoisotopic): 429.2338AlogP: 5.62#Rotatable Bonds: 7Polar Surface Area: 55.40Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 4.70CX LogP: 5.86CX LogD: 5.85Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.62Np Likeness Score: -0.03
References 1. (2015) Chemical compounds,