The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9040518, 72 ID: ALA3658917
PubChem CID: 71241850
Max Phase: Preclinical
Molecular Formula: C25H32N2O6S
Molecular Weight: 488.61
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCC[C@]1(CC)CS(=O)(=O)c2cc(C(=O)NCC(=O)O)c(OC)cc2[C@H](c2ccccc2)N1
Standard InChI: InChI=1S/C25H32N2O6S/c1-4-6-12-25(5-2)16-34(31,32)21-14-18(24(30)26-15-22(28)29)20(33-3)13-19(21)23(27-25)17-10-8-7-9-11-17/h7-11,13-14,23,27H,4-6,12,15-16H2,1-3H3,(H,26,30)(H,28,29)/t23-,25+/m0/s1
Standard InChI Key: XINIUFPBMDNRFW-UKILVPOCSA-N
Molfile:
RDKit 2D
34 36 0 0 1 0 0 0 0 0999 V2000
0.6819 -5.2220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4977 -4.3420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0556 -2.9078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0759 -1.8072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6852 -0.3846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6548 0.7277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8249 0.4615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3514 1.0778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.7286 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-1.0569 2.2970 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0568 2.2971 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3515 1.0777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4523 2.0983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8856 1.6561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9837 2.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1310 2.3275 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.6477 4.1419 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.7458 5.1650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4097 6.6277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2877 7.4457 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.2624 6.9794 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.2194 0.1937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.6526 -0.2516 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.9180 -1.4219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1198 -0.8265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6852 -0.3847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7500 -1.5574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7500 -1.5574 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.4011 -2.9095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4925 -4.1079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0733 -5.4909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5615 -5.6793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4687 -4.4848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8879 -3.1018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
5 4 1 1
5 6 1 0
6 7 1 0
5 8 1 0
8 9 1 0
9 10 2 0
9 11 2 0
9 12 1 0
12 13 2 0
13 14 1 0
14 15 1 0
15 16 2 0
15 17 1 0
17 18 1 0
18 19 1 0
19 20 2 0
19 21 1 0
14 22 2 0
22 23 1 0
23 24 1 0
22 25 1 0
25 26 2 0
26 12 1 0
26 27 1 0
27 28 1 0
28 5 1 0
27 29 1 1
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 488.61Molecular Weight (Monoisotopic): 488.1981AlogP: 3.31#Rotatable Bonds: 9Polar Surface Area: 121.80Molecular Species: ACIDHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 2.37CX Basic pKa: 4.52CX LogP: 1.08CX LogD: -0.35Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.49Np Likeness Score: -0.28
References 1. (2015) Chemical compounds,