The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9062048, 155 ID: ALA3659046
PubChem CID: 54769961
Max Phase: Preclinical
Molecular Formula: C24H32F3N5O2
Molecular Weight: 479.55
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)C(O)[C@H]1CC[C@@H](N2CC(NC(=O)CNc3nccc4ncc(C(F)(F)F)cc34)C2)CC1
Standard InChI: InChI=1S/C24H32F3N5O2/c1-14(2)22(34)15-3-5-18(6-4-15)32-12-17(13-32)31-21(33)11-30-23-19-9-16(24(25,26)27)10-29-20(19)7-8-28-23/h7-10,14-15,17-18,22,34H,3-6,11-13H2,1-2H3,(H,28,30)(H,31,33)/t15-,18+,22?
Standard InChI Key: LRTHXEJLGFGXPG-HQFBBTJKSA-N
Molfile:
RDKit 2D
34 37 0 0 1 0 0 0 0 0999 V2000
14.9264 -8.4667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0170 -7.6837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8844 -8.0800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2956 -6.2089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4282 -5.8126 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.1583 -5.2296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4345 -3.7552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2959 -2.7788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8923 -3.2739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6046 -4.7511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7433 -5.7275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5926 -2.5235 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2044 -1.0746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8003 -1.4887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1437 -2.9117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4990 -0.7409 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2003 -1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2024 -2.6932 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 -0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -3.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -5.2508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3379 -5.8515 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.2596 -5.8505 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.2984 -6.4508 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 1 0
4 5 1 0
6 4 1 1
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 6 1 0
9 12 1 1
12 13 1 0
13 14 1 0
14 15 1 0
15 12 1 0
14 16 1 0
16 17 1 0
17 18 2 0
17 19 1 0
19 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 21 1 0
30 25 1 0
28 31 1 0
31 32 1 0
31 33 1 0
31 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 479.55Molecular Weight (Monoisotopic): 479.2508AlogP: 3.44#Rotatable Bonds: 7Polar Surface Area: 90.38Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.53CX Basic pKa: 7.54CX LogP: 2.69CX LogD: 2.32Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.56Np Likeness Score: -1.08
References 1. (2015) Cyclohexyl-azetidinyl antagonists of CCR2, 2. (2015) Cyclohexyl-azetidinyl antagonists of CCR2,