The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9062048, 161::US9062048, 162 ID: ALA3659049
PubChem CID: 54770175
Max Phase: Preclinical
Molecular Formula: C23H25F3N6O2S
Molecular Weight: 506.55
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CNc1ncnc2ccc(C(F)(F)F)cc12)N[C@H]1C[C@@H](N2CCC(O)(c3cncs3)CC2)C1
Standard InChI: InChI=1S/C23H25F3N6O2S/c24-23(25,26)14-1-2-18-17(7-14)21(30-12-29-18)28-11-20(33)31-15-8-16(9-15)32-5-3-22(34,4-6-32)19-10-27-13-35-19/h1-2,7,10,12-13,15-16,34H,3-6,8-9,11H2,(H,31,33)(H,28,29,30)/t15-,16+
Standard InChI Key: LCOOFJGNYNCBNF-IYBDPMFKSA-N
Molfile:
RDKit 2D
35 39 0 0 1 0 0 0 0 0999 V2000
14.2805 -4.8046 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.1583 -5.2296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4346 -3.7552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2959 -2.7788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8923 -3.2739 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.6046 -4.7511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7433 -5.7275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5926 -2.5235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1437 -2.9117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8003 -1.4887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2044 -1.0746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4990 -0.7409 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2003 -1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2024 -2.6932 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 -0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -3.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -5.2508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3379 -5.8515 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.2596 -5.8505 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.2984 -6.4508 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.8515 -6.6781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8605 -7.7706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1114 -9.0702 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.6440 -8.7593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4861 -7.2677 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 2 1 0
8 5 1 6
8 9 1 0
9 10 1 0
10 11 1 0
11 8 1 0
10 12 1 6
12 13 1 0
13 14 2 0
13 15 1 0
15 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 17 1 0
26 21 1 0
24 27 1 0
27 28 1 0
27 29 1 0
27 30 1 0
2 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 506.55Molecular Weight (Monoisotopic): 506.1712AlogP: 3.15#Rotatable Bonds: 6Polar Surface Area: 103.27Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.18CX Basic pKa: 7.58CX LogP: 1.11CX LogD: 0.71Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.47Np Likeness Score: -1.27
References 1. (2015) Cyclohexyl-azetidinyl antagonists of CCR2,