US9062048, 161::US9062048, 162

ID: ALA3659049

PubChem CID: 54770175

Max Phase: Preclinical

Molecular Formula: C23H25F3N6O2S

Molecular Weight: 506.55

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(CNc1ncnc2ccc(C(F)(F)F)cc12)N[C@H]1C[C@@H](N2CCC(O)(c3cncs3)CC2)C1

Standard InChI:  InChI=1S/C23H25F3N6O2S/c24-23(25,26)14-1-2-18-17(7-14)21(30-12-29-18)28-11-20(33)31-15-8-16(9-15)32-5-3-22(34,4-6-32)19-10-27-13-35-19/h1-2,7,10,12-13,15-16,34H,3-6,8-9,11H2,(H,31,33)(H,28,29,30)/t15-,16+

Standard InChI Key:  LCOOFJGNYNCBNF-IYBDPMFKSA-N

Molfile:  

     RDKit          2D

 35 39  0  0  1  0  0  0  0  0999 V2000
   14.2805   -4.8046    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.1583   -5.2296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4346   -3.7552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2959   -2.7788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8923   -3.2739    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.6046   -4.7511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7433   -5.7275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5926   -2.5235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1437   -2.9117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8003   -1.4887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2044   -1.0746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4990   -0.7409    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2003   -1.4932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2024   -2.6932    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8990   -0.7455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6003   -1.4977    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -3.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -5.2508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3379   -5.8515    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2596   -5.8505    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2984   -6.4508    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   12.8515   -6.6781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8605   -7.7706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1114   -9.0702    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.6440   -8.7593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4861   -7.2677    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  2  1  0
  8  5  1  6
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11  8  1  0
 10 12  1  6
 12 13  1  0
 13 14  2  0
 13 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 17  1  0
 26 21  1  0
 24 27  1  0
 27 28  1  0
 27 29  1  0
 27 30  1  0
  2 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 31  1  0
M  END

Associated Targets(Human)

CCRL2 Tchem C-C chemokine receptor-like 2 (177 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 506.55Molecular Weight (Monoisotopic): 506.1712AlogP: 3.15#Rotatable Bonds: 6
Polar Surface Area: 103.27Molecular Species: NEUTRALHBA: 8HBD: 3
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.18CX Basic pKa: 7.58CX LogP: 1.11CX LogD: 0.71
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.47Np Likeness Score: -1.27

References

1.  (2015)  Cyclohexyl-azetidinyl antagonists of CCR2, 

Source

Source(1):