The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9062048, 170 ID: ALA3659054
PubChem CID: 54770392
Max Phase: Preclinical
Molecular Formula: C25H31F5N4O2
Molecular Weight: 514.54
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCC(O)[C@H]1CC[C@@H](N2CC(NC(=O)CNc3nccc4ccc(C(F)(F)C(F)(F)F)cc34)C2)CC1
Standard InChI: InChI=1S/C25H31F5N4O2/c1-2-21(35)16-4-7-19(8-5-16)34-13-18(14-34)33-22(36)12-32-23-20-11-17(24(26,27)25(28,29)30)6-3-15(20)9-10-31-23/h3,6,9-11,16,18-19,21,35H,2,4-5,7-8,12-14H2,1H3,(H,31,32)(H,33,36)/t16-,19+,21?
Standard InChI Key: GTWCIZBJSHIPBT-DSENVFOLSA-N
Molfile:
RDKit 2D
36 39 0 0 1 0 0 0 0 0999 V2000
14.9264 -8.4667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0170 -7.6837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2956 -6.2089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4282 -5.8126 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.1583 -5.2296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4345 -3.7552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2959 -2.7788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8923 -3.2739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6046 -4.7511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7433 -5.7275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5926 -2.5235 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2044 -1.0746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8003 -1.4887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1437 -2.9117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4990 -0.7409 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2003 -1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2024 -2.6932 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 -0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -3.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -5.2508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2596 -5.8505 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.2599 -4.6507 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.5983 -6.0021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5983 -7.2021 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.6377 -5.4024 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.6374 -6.6022 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
5 3 1 1
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 5 1 0
8 11 1 1
11 12 1 0
12 13 1 0
13 14 1 0
14 11 1 0
13 15 1 0
15 16 1 0
16 17 2 0
16 18 1 0
18 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 20 1 0
29 24 1 0
27 30 1 0
30 31 1 0
30 32 1 0
30 33 1 0
33 34 1 0
33 35 1 0
33 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 514.54Molecular Weight (Monoisotopic): 514.2367AlogP: 4.43#Rotatable Bonds: 8Polar Surface Area: 77.49Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.09CX Basic pKa: 7.60CX LogP: 3.86CX LogD: 3.40Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.45Np Likeness Score: -0.68
References 1. (2015) Cyclohexyl-azetidinyl antagonists of CCR2,