The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8575145, 71 ID: ALA3660067
PubChem CID: 58303730
Max Phase: Preclinical
Molecular Formula: C28H27N5O2
Molecular Weight: 465.56
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: OC1(COc2cccc3ccc(-c4nnc5ccccn45)nc23)CCN(Cc2ccccc2)CC1
Standard InChI: InChI=1S/C28H27N5O2/c34-28(14-17-32(18-15-28)19-21-7-2-1-3-8-21)20-35-24-10-6-9-22-12-13-23(29-26(22)24)27-31-30-25-11-4-5-16-33(25)27/h1-13,16,34H,14-15,17-20H2
Standard InChI Key: BXMIWWRRFNMNOL-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 40 0 0 0 0 0 0 0 0999 V2000
6.2385 -0.8914 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2003 -1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 -0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -3.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -3.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -5.2508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0843 -6.1089 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.5458 -7.5361 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.0450 -7.5380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0471 -8.6542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5147 -8.3444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9803 -6.9185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9782 -5.8023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5105 -6.1121 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9026 -2.2040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9055 -3.7040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2059 -4.4515 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2119 -5.9523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5141 -6.6984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5223 -8.1984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8253 -8.9415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1203 -8.1845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1123 -6.6845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8092 -5.9415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5036 -3.6990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5007 -2.1990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 5 1 0
14 9 1 0
12 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 15 1 0
23 18 1 0
2 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
26 34 1 0
34 35 1 0
35 2 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 465.56Molecular Weight (Monoisotopic): 465.2165AlogP: 4.35#Rotatable Bonds: 6Polar Surface Area: 75.78Molecular Species: BASEHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.92CX Basic pKa: 8.55CX LogP: 3.19CX LogD: 2.02Aromatic Rings: 5Heavy Atoms: 35QED Weighted: 0.40Np Likeness Score: -1.22
References 1. (2013) Triazolopyridine compounds as PIM kinase inhibitors,