US8598217, 84

ID: ALA3660193

PubChem CID: 49785960

Max Phase: Preclinical

Molecular Formula: C25H21N5O

Molecular Weight: 407.48

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN(C)Cc1ccc2nc(C(=O)c3ccnc(-c4cncc5ccccc45)c3)[nH]c2c1

Standard InChI:  InChI=1S/C25H21N5O/c1-30(2)15-16-7-8-21-23(11-16)29-25(28-21)24(31)17-9-10-27-22(12-17)20-14-26-13-18-5-3-4-6-19(18)20/h3-14H,15H2,1-2H3,(H,28,29)

Standard InChI Key:  VLICGMIYFAGXFE-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
   -5.4693   -6.4449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2693   -6.4535    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6623   -5.4184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5273   -7.7581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0265   -7.7688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2831   -9.0716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2169   -9.0792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9734   -7.7839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4415   -7.4799    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5868   -5.9998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2386   -5.3719    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.2300   -6.4811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2700   -6.4735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8888   -5.2533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9261   -5.8568    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8943   -3.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1945   -3.0045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1969   -1.5045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8991   -0.7525    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5987   -1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5965   -3.0004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -3.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
 12  8  1  0
 12 13  2  0
 13  5  1  0
 10 14  1  0
 14 15  2  0
 14 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 20 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 22  1  0
 31 26  1  0
M  END

Associated Targets(non-human)

CDK4 Cyclin-dependent kinase 4 (20 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 407.48Molecular Weight (Monoisotopic): 407.1746AlogP: 4.47#Rotatable Bonds: 5
Polar Surface Area: 74.77Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 8.95CX Basic pKa: 8.01CX LogP: 3.24CX LogD: 2.85
Aromatic Rings: 5Heavy Atoms: 31QED Weighted: 0.44Np Likeness Score: -0.98

References

1.  (2013)  Imidazole derivatives and their use as modulators of cyclin dependent kinases, 

Source

Source(1):