The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8598217, 86 ID: ALA3660194
PubChem CID: 49785964
Max Phase: Preclinical
Molecular Formula: C28H26N6O
Molecular Weight: 462.56
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN1CCN(Cc2ccc3nc(C(=O)c4ccnc(-c5cncc6ccccc56)c4)[nH]c3c2)CC1
Standard InChI: InChI=1S/C28H26N6O/c1-33-10-12-34(13-11-33)18-19-6-7-24-26(14-19)32-28(31-24)27(35)20-8-9-30-25(15-20)23-17-29-16-21-4-2-3-5-22(21)23/h2-9,14-17H,10-13,18H2,1H3,(H,31,32)
Standard InChI Key: ALOWRTMFJGVUFD-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 40 0 0 0 0 0 0 0 0999 V2000
-6.3383 -2.7983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7471 -3.8426 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.5082 -5.1352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7693 -6.4406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2693 -6.4535 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.5273 -7.7581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0265 -7.7688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2831 -9.0716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2169 -9.0792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9734 -7.7839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4415 -7.4799 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5868 -5.9998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2386 -5.3719 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2300 -6.4811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2700 -6.4735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8888 -5.2533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9261 -5.8568 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8943 -3.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1945 -3.0045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1969 -1.5045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8991 -0.7525 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5987 -1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5965 -3.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -3.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5083 -5.1608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2472 -3.8554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 1 0
14 10 1 0
14 15 2 0
15 7 1 0
12 16 1 0
16 17 2 0
16 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
22 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 24 1 0
33 28 1 0
5 34 1 0
34 35 1 0
35 2 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 462.56Molecular Weight (Monoisotopic): 462.2168AlogP: 4.15#Rotatable Bonds: 5Polar Surface Area: 78.01Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.91CX Basic pKa: 7.68CX LogP: 3.25CX LogD: 2.98Aromatic Rings: 5Heavy Atoms: 35QED Weighted: 0.40Np Likeness Score: -1.05
References 1. (2013) Imidazole derivatives and their use as modulators of cyclin dependent kinases,