US8598217, 103

ID: ALA3660197

PubChem CID: 49784847

Max Phase: Preclinical

Molecular Formula: C27H27F2N5O2

Molecular Weight: 491.54

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(F)c(F)c1-c1cc(C(=O)c2nc3ccc(N4CCC(N(C)C)CC4)cc3[nH]2)ccn1

Standard InChI:  InChI=1S/C27H27F2N5O2/c1-33(2)17-9-12-34(13-10-17)18-4-6-20-21(15-18)32-27(31-20)26(35)16-8-11-30-22(14-16)24-23(36-3)7-5-19(28)25(24)29/h4-8,11,14-15,17H,9-10,12-13H2,1-3H3,(H,31,32)

Standard InChI Key:  QFPALJFKLKEVNR-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
   -0.3269  -11.9494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2768  -10.9123    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7776  -10.9168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5210  -12.2196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0210  -12.2272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7776  -10.9320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9776  -10.9380    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    4.0342   -9.6291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6395   -8.5930    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.5341   -9.6215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7883   -8.3192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5428   -7.0227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7974   -5.7210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2973   -5.7159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4572   -7.0123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2883   -8.3139    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5497   -4.4224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7497   -4.4245    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8032   -3.1233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4133   -1.7530    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3114   -2.9665    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5987    1.5004    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6012    3.0004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9015    3.7484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1993    2.9963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1969    1.4963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8967    0.7484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5018    3.7420    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5392    3.1388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5058    4.9420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  6  8  1  0
  8  9  1  0
  8 10  2  0
 10  3  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
 13 17  1  0
 17 18  2  0
 17 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 26 27  1  0
 27 19  1  0
 24 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 28  1  0
 31 34  1  0
 34 35  1  0
 34 36  1  0
M  END

Associated Targets(non-human)

CDK4 Cyclin-dependent kinase 4 (20 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 491.54Molecular Weight (Monoisotopic): 491.2133AlogP: 4.67#Rotatable Bonds: 6
Polar Surface Area: 74.35Molecular Species: BASEHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 9.38CX Basic pKa: 10.00CX LogP: 3.54CX LogD: 1.82
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.40Np Likeness Score: -1.14

References

1.  (2013)  Imidazole derivatives and their use as modulators of cyclin dependent kinases, 

Source

Source(1):