The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8598217, 163 ID: ALA3660199
PubChem CID: 66599420
Max Phase: Preclinical
Molecular Formula: C26H23N7O
Molecular Weight: 449.52
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(c1ccnc(-c2cncc3ccccc23)c1)c1nc2nc(N3CCCNCC3)ccc2[nH]1
Standard InChI: InChI=1S/C26H23N7O/c34-24(17-8-10-29-22(14-17)20-16-28-15-18-4-1-2-5-19(18)20)26-30-21-6-7-23(31-25(21)32-26)33-12-3-9-27-11-13-33/h1-2,4-8,10,14-16,27H,3,9,11-13H2,(H,30,31,32)
Standard InChI Key: ZORNFEJUOXUUQB-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 39 0 0 0 0 0 0 0 0999 V2000
4.9261 -5.8568 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8888 -5.2533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8943 -3.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1945 -3.0045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1969 -1.5045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8991 -0.7525 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5987 -1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5965 -3.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -3.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5868 -5.9998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4415 -7.4799 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.9734 -7.7839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2168 -9.0792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2831 -9.0716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0265 -7.7688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2700 -6.4735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2300 -6.4811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2386 -5.3719 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.0401 -10.3675 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2118 -11.6268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6634 -13.0572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0634 -13.5959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3574 -12.8372 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.5711 -11.3525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5435 -10.2598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 3 1 0
7 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 9 1 0
18 13 1 0
2 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
26 27 1 0
27 19 1 0
23 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 28 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 449.52Molecular Weight (Monoisotopic): 449.1964AlogP: 3.60#Rotatable Bonds: 4Polar Surface Area: 99.69Molecular Species: BASEHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.67CX Basic pKa: 9.64CX LogP: 2.01CX LogD: 0.90Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.40Np Likeness Score: -0.93
References 1. (2013) Imidazole derivatives and their use as modulators of cyclin dependent kinases,