US8598217, 163

ID: ALA3660199

PubChem CID: 66599420

Max Phase: Preclinical

Molecular Formula: C26H23N7O

Molecular Weight: 449.52

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(c1ccnc(-c2cncc3ccccc23)c1)c1nc2nc(N3CCCNCC3)ccc2[nH]1

Standard InChI:  InChI=1S/C26H23N7O/c34-24(17-8-10-29-22(14-17)20-16-28-15-18-4-1-2-5-19(18)20)26-30-21-6-7-23(31-25(21)32-26)33-12-3-9-27-11-13-33/h1-2,4-8,10,14-16,27H,3,9,11-13H2,(H,30,31,32)

Standard InChI Key:  ZORNFEJUOXUUQB-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 39  0  0  0  0  0  0  0  0999 V2000
    4.9261   -5.8568    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8888   -5.2533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8943   -3.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1945   -3.0045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1969   -1.5045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8991   -0.7525    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5987   -1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5965   -3.0004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -3.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5868   -5.9998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4415   -7.4799    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.9734   -7.7839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2168   -9.0792    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2831   -9.0716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0265   -7.7688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2700   -6.4735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2300   -6.4811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2386   -5.3719    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0401  -10.3675    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2118  -11.6268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6634  -13.0572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0634  -13.5959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3574  -12.8372    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5711  -11.3525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5435  -10.2598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  3  1  0
  7  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18  9  1  0
 18 13  1  0
  2 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 26 27  1  0
 27 19  1  0
 23 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 28  1  0
M  END

Associated Targets(non-human)

CDK4 Cyclin-dependent kinase 4 (20 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 449.52Molecular Weight (Monoisotopic): 449.1964AlogP: 3.60#Rotatable Bonds: 4
Polar Surface Area: 99.69Molecular Species: BASEHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 8.67CX Basic pKa: 9.64CX LogP: 2.01CX LogD: 0.90
Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.40Np Likeness Score: -0.93

References

1.  (2013)  Imidazole derivatives and their use as modulators of cyclin dependent kinases, 

Source

Source(1):