The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8598217, 182 ID: ALA3660204
PubChem CID: 66614431
Max Phase: Preclinical
Molecular Formula: C26H22N6O3S
Molecular Weight: 498.57
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(c1ccnc(-c2cncc3ccccc23)c1)c1nc2ccc(S(=O)(=O)N3CCNCC3)cc2[nH]1
Standard InChI: InChI=1S/C26H22N6O3S/c33-25(17-7-8-29-23(13-17)21-16-28-15-18-3-1-2-4-20(18)21)26-30-22-6-5-19(14-24(22)31-26)36(34,35)32-11-9-27-10-12-32/h1-8,13-16,27H,9-12H2,(H,30,31)
Standard InChI Key: QEJMSQXNOLMRQP-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 41 0 0 0 0 0 0 0 0999 V2000
4.9261 -5.8568 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8888 -5.2533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8943 -3.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1945 -3.0045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1969 -1.5045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8991 -0.7525 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5987 -1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5965 -3.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -3.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5868 -5.9998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4415 -7.4799 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.9734 -7.7839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2168 -9.0792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2831 -9.0716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0265 -7.7688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2700 -6.4735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2300 -6.4811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2386 -5.3719 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.5274 -7.7612 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-4.1218 -6.7187 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.9219 -6.7251 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.2852 -9.0566 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.5426 -10.3599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3000 -11.6547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7999 -11.6461 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.5425 -10.3428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7851 -9.0481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 3 1 0
7 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 9 1 0
18 13 1 0
2 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
26 27 1 0
27 19 1 0
24 28 1 0
28 29 2 0
28 30 2 0
28 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 31 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 498.57Molecular Weight (Monoisotopic): 498.1474AlogP: 3.00#Rotatable Bonds: 5Polar Surface Area: 120.94Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 6.66CX Basic pKa: 7.33CX LogP: 1.48CX LogD: 1.48Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.36Np Likeness Score: -1.20
References 1. (2013) Imidazole derivatives and their use as modulators of cyclin dependent kinases,