The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8598217, 148 ID: ALA3660206
PubChem CID: 74982336
Max Phase: Preclinical
Molecular Formula: C27H27F2N5O2
Molecular Weight: 491.54
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(F)c(F)c1-c1cccc(C(=O)c2nc3nc(N4CCC(N(C)C)CC4)ccc3[nH]2)c1
Standard InChI: InChI=1S/C27H27F2N5O2/c1-33(2)18-11-13-34(14-12-18)22-10-8-20-26(31-22)32-27(30-20)25(35)17-6-4-5-16(15-17)23-21(36-3)9-7-19(28)24(23)29/h4-10,15,18H,11-14H2,1-3H3,(H,30,31,32)
Standard InChI Key: AUFCGOPELDKYRB-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
-2.5435 -3.3654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9472 -4.4067 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.7015 -5.7043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2015 -5.6967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9580 -6.9919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2146 -8.2947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8198 -9.3309 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.7146 -8.3023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1199 -9.3446 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.9579 -7.0071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4572 -7.0123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2883 -8.3139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7883 -8.3192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5428 -7.0227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7974 -5.7210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2973 -5.7159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5497 -4.4224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7497 -4.4245 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8032 -3.1233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4133 -1.7530 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3114 -2.9665 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 3.0008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2978 3.7529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2954 5.2529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0048 6.0009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3026 5.2488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3002 3.7488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0103 7.5017 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0513 8.0986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0270 8.1052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
6 8 1 0
8 9 1 0
8 10 2 0
10 3 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
15 17 1 0
17 18 2 0
17 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
26 27 1 0
27 19 1 0
23 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 28 1 0
31 34 1 0
34 35 1 0
34 36 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 491.54Molecular Weight (Monoisotopic): 491.2133AlogP: 4.67#Rotatable Bonds: 6Polar Surface Area: 74.35Molecular Species: BASEHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.75CX Basic pKa: 9.82CX LogP: 3.52CX LogD: 2.34Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.40Np Likeness Score: -1.10
References 1. (2013) Imidazole derivatives and their use as modulators of cyclin dependent kinases,