The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8598217, 166 ID: ALA3660207
PubChem CID: 66608953
Max Phase: Preclinical
Molecular Formula: C27H21N7O
Molecular Weight: 459.51
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: N#Cc1ccc(C(=O)c2nc3nc(N4CCNCC4)ccc3[nH]2)cc1-c1cncc2ccccc12
Standard InChI: InChI=1S/C27H21N7O/c28-14-18-6-5-17(13-21(18)22-16-30-15-19-3-1-2-4-20(19)22)25(35)27-31-23-7-8-24(32-26(23)33-27)34-11-9-29-10-12-34/h1-8,13,15-16,29H,9-12H2,(H,31,32,33)
Standard InChI Key: RSAQLGNUSSDKPJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 40 0 0 0 0 0 0 0 0999 V2000
4.9261 -5.8568 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8888 -5.2533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8943 -3.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1945 -3.0045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1969 -1.5045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8991 -0.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9015 0.7483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9034 1.9483 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5987 -1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5965 -3.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -3.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5868 -5.9998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4415 -7.4799 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.9734 -7.7839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2168 -9.0792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2831 -9.0716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0265 -7.7688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2700 -6.4735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2300 -6.4811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2386 -5.3719 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.0401 -10.3675 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2988 -11.6716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0574 -12.9656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5574 -12.9556 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.2987 -11.6516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5401 -10.3576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 3 0
6 9 1 0
9 10 2 0
10 3 1 0
9 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 11 1 0
20 15 1 0
2 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
28 29 1 0
29 21 1 0
25 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 30 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 459.51Molecular Weight (Monoisotopic): 459.1808AlogP: 3.69#Rotatable Bonds: 4Polar Surface Area: 110.59Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.08CX Basic pKa: 8.42CX LogP: 3.11CX LogD: 2.29Aromatic Rings: 5Heavy Atoms: 35QED Weighted: 0.39Np Likeness Score: -1.08
References 1. (2013) Imidazole derivatives and their use as modulators of cyclin dependent kinases,