The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-[3-(5-carboxythien-2-yl)benzo[g]quinoxalin-2-yl]thiophene-2-carboxylic acid ID: ALA366185
PubChem CID: 44399015
Max Phase: Preclinical
Molecular Formula: C22H12N2O4S2
Molecular Weight: 432.48
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)c1ccc(-c2nc3cc4ccccc4cc3nc2-c2ccc(C(=O)O)s2)s1
Standard InChI: InChI=1S/C22H12N2O4S2/c25-21(26)17-7-5-15(29-17)19-20(16-6-8-18(30-16)22(27)28)24-14-10-12-4-2-1-3-11(12)9-13(14)23-19/h1-10H,(H,25,26)(H,27,28)
Standard InChI Key: AGLPPKMGJNQLMZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 34 0 0 0 0 0 0 0 0999 V2000
2.7667 0.0208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7542 0.8500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0500 -0.4000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.0417 1.2583 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.4667 1.2708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4792 -0.3917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2250 0.9458 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.5750 -1.2125 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.7667 1.5583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3792 -1.3750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3292 0.8375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3292 0.0083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5417 2.0958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2292 -0.0500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7875 -0.6542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3542 2.2708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5917 1.4833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7250 -2.1292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6167 -0.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6125 1.2458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0958 0.8333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0958 0.0083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0667 2.1583 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2417 -2.8000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9375 0.7333 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5417 -2.2042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.8125 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8125 1.2458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5250 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5250 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 2 0
4 2 2 0
5 2 1 0
6 1 1 0
7 5 1 0
8 6 1 0
9 7 1 0
10 8 1 0
11 12 1 0
12 3 1 0
13 5 2 0
14 6 2 0
15 14 1 0
16 13 1 0
17 9 1 0
18 10 1 0
19 12 2 0
20 11 2 0
21 22 1 0
22 19 1 0
23 17 2 0
24 18 2 0
25 17 1 0
26 18 1 0
27 22 2 0
28 21 2 0
29 30 2 0
30 27 1 0
10 15 2 0
4 11 1 0
9 16 2 0
21 20 1 0
28 29 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 432.48Molecular Weight (Monoisotopic): 432.0238AlogP: 5.64#Rotatable Bonds: 4Polar Surface Area: 100.38Molecular Species: ACIDHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.02CX Basic pKa: ┄CX LogP: 5.49CX LogD: -1.36Aromatic Rings: 5Heavy Atoms: 30QED Weighted: 0.36Np Likeness Score: -0.38
References 1. Székelyhidi Z, Pató J, Wáczek F, Bánhegyi P, Hegymegi-Barakonyi B, Erös D, Mészáros G, Hollósy F, Hafenbradl D, Obert S, Klebl B, Kéri G, Orfi L.. (2005) Synthesis of selective SRPK-1 inhibitors: novel tricyclic quinoxaline derivatives., 15 (13): [PMID:15925511 ] [10.1016/j.bmcl.2005.04.064 ]