US8912224, 206

ID: ALA3661890

PubChem CID: 91754848

Max Phase: Preclinical

Molecular Formula: C25H26N2O4S

Molecular Weight: 450.56

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(NC(CCO)C1CC1)c1cnc(Oc2ccc3c(c2)CC[C@@H](c2ccccc2)O3)s1

Standard InChI:  InChI=1S/C25H26N2O4S/c28-13-12-20(16-6-7-16)27-24(29)23-15-26-25(32-23)30-19-9-11-22-18(14-19)8-10-21(31-22)17-4-2-1-3-5-17/h1-5,9,11,14-16,20-21,28H,6-8,10,12-13H2,(H,27,29)/t20?,21-/m0/s1

Standard InChI Key:  CZTIDWZWCCSVHA-LBAQZLPGSA-N

Molfile:  

     RDKit          2D

 32 36  0  0  1  0  0  0  0  0999 V2000
    1.1518  -10.1733    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6672   -9.0755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8248   -8.9130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4309   -7.5400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5420   -6.3307    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.9498   -6.4949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4321   -7.5937    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8372   -5.2877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3372   -5.2929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8056   -3.8679    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5951   -3.0039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    1.5000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1968    1.5003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4971    0.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7950    1.5045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7926    3.0045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4924    3.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1945    3.0004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3786   -3.8595    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9227   -7.3758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2064   -7.9864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0392   -6.4957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  6  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 16  1  0
 21 22  2  0
 22 13  1  0
 18 23  1  1
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 11 29  1  0
 29  8  1  0
  4 30  1  0
 30 31  1  0
 31 32  1  0
 32 30  1  0
M  END

Associated Targets(Human)

SLC8A1 Tchem Sodium/calcium exchanger 1 (416 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 450.56Molecular Weight (Monoisotopic): 450.1613AlogP: 4.89#Rotatable Bonds: 8
Polar Surface Area: 80.68Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 12.47CX Basic pKa: CX LogP: 4.34CX LogD: 4.34
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.51Np Likeness Score: 0.00

References

1.  (2014)  Substituted 2-(chroman-6-yloxy)-thiazoles and their use as pharmaceuticals, 

Source

Source(1):