The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8912224, 206 ID: ALA3661890
PubChem CID: 91754848
Max Phase: Preclinical
Molecular Formula: C25H26N2O4S
Molecular Weight: 450.56
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NC(CCO)C1CC1)c1cnc(Oc2ccc3c(c2)CC[C@@H](c2ccccc2)O3)s1
Standard InChI: InChI=1S/C25H26N2O4S/c28-13-12-20(16-6-7-16)27-24(29)23-15-26-25(32-23)30-19-9-11-22-18(14-19)8-10-21(31-22)17-4-2-1-3-5-17/h1-5,9,11,14-16,20-21,28H,6-8,10,12-13H2,(H,27,29)/t20?,21-/m0/s1
Standard InChI Key: CZTIDWZWCCSVHA-LBAQZLPGSA-N
Molfile:
RDKit 2D
32 36 0 0 1 0 0 0 0 0999 V2000
1.1518 -10.1733 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.6672 -9.0755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8248 -8.9130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4309 -7.5400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5420 -6.3307 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.9498 -6.4949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4321 -7.5937 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8372 -5.2877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3372 -5.2929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8056 -3.8679 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1968 1.5003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4971 0.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7950 1.5045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7926 3.0045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4924 3.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1945 3.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3786 -3.8595 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-2.9227 -7.3758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2064 -7.9864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0392 -6.4957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 2 0
6 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 16 1 0
21 22 2 0
22 13 1 0
18 23 1 1
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
11 29 1 0
29 8 1 0
4 30 1 0
30 31 1 0
31 32 1 0
32 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 450.56Molecular Weight (Monoisotopic): 450.1613AlogP: 4.89#Rotatable Bonds: 8Polar Surface Area: 80.68Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.47CX Basic pKa: ┄CX LogP: 4.34CX LogD: 4.34Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.51Np Likeness Score: 0.00
References 1. (2014) Substituted 2-(chroman-6-yloxy)-thiazoles and their use as pharmaceuticals,