US8912224, 214

ID: ALA3661898

PubChem CID: 71293148

Max Phase: Preclinical

Molecular Formula: C23H22N2O4S

Molecular Weight: 422.51

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(c1cnc(Oc2ccc3c(c2)CC[C@@H](c2ccccc2)O3)s1)N1CCOCC1

Standard InChI:  InChI=1S/C23H22N2O4S/c26-22(25-10-12-27-13-11-25)21-15-24-23(30-21)28-18-7-9-20-17(14-18)6-8-19(29-20)16-4-2-1-3-5-16/h1-5,7,9,14-15,19H,6,8,10-13H2/t19-/m0/s1

Standard InChI Key:  NHEZKTVROFXMMG-IBGZPJMESA-N

Molfile:  

     RDKit          2D

 30 34  0  0  1  0  0  0  0  0999 V2000
    1.4321   -7.5937    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.9498   -6.4949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5420   -6.3307    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4322   -7.5380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9229   -7.3709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5234   -5.9963    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6333   -4.7890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1427   -4.9561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8372   -5.2877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3372   -5.2929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8056   -3.8679    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5951   -3.0039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    1.5000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1968    1.5003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4971    0.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7950    1.5045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7926    3.0045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4924    3.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1945    3.0004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3786   -3.8595    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  3  1  0
  2  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 17  1  0
 22 23  2  0
 23 14  1  0
 19 24  1  1
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 12 30  1  0
 30  9  1  0
M  END

Associated Targets(Human)

SLC8A1 Tchem Sodium/calcium exchanger 1 (416 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 422.51Molecular Weight (Monoisotopic): 422.1300AlogP: 4.47#Rotatable Bonds: 4
Polar Surface Area: 60.89Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 4.14CX LogD: 4.14
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.62Np Likeness Score: -0.73

References

1.  (2014)  Substituted 2-(chroman-6-yloxy)-thiazoles and their use as pharmaceuticals, 

Source

Source(1):