The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8912224, 327 ID: ALA3662002
PubChem CID: 71293225
Max Phase: Preclinical
Molecular Formula: C26H27N3O4S
Molecular Weight: 477.59
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccccc1C1CCc2cc(Oc3ncc(CNC(=O)CN4CCCC4=O)s3)ccc2O1
Standard InChI: InChI=1S/C26H27N3O4S/c1-17-5-2-3-6-21(17)23-10-8-18-13-19(9-11-22(18)33-23)32-26-28-15-20(34-26)14-27-24(30)16-29-12-4-7-25(29)31/h2-3,5-6,9,11,13,15,23H,4,7-8,10,12,14,16H2,1H3,(H,27,30)
Standard InChI Key: CAFJWFVUPVMRNG-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
3.9010 0.4475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8991 -0.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1969 -1.5045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1945 -3.0045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8943 -3.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5965 -3.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5987 -1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1984 1.4977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.4971 0.7454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8506 1.3617 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-8.8505 0.2435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.0959 -1.0529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.6977 -2.4250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8096 -3.6348 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-8.4124 -5.0092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.6051 -5.1409 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.5243 -6.2191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.1271 -7.5935 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-9.5844 -7.8905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.7359 -9.3829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.3635 -9.9881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.3637 -8.8699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1692 -8.9841 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.6298 -0.7359 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 2 0
21 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 24 1 0
28 29 2 0
18 30 1 0
30 15 1 0
13 31 2 0
31 32 1 0
32 33 2 0
33 11 1 0
33 34 1 0
34 8 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 477.59Molecular Weight (Monoisotopic): 477.1722AlogP: 4.55#Rotatable Bonds: 7Polar Surface Area: 80.76Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.77CX Basic pKa: ┄CX LogP: 3.86CX LogD: 3.86Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.54Np Likeness Score: -0.93
References 1. (2014) Substituted 2-(chroman-6-yloxy)-thiazoles and their use as pharmaceuticals,