US8912224, 327

ID: ALA3662002

PubChem CID: 71293225

Max Phase: Preclinical

Molecular Formula: C26H27N3O4S

Molecular Weight: 477.59

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccccc1C1CCc2cc(Oc3ncc(CNC(=O)CN4CCCC4=O)s3)ccc2O1

Standard InChI:  InChI=1S/C26H27N3O4S/c1-17-5-2-3-6-21(17)23-10-8-18-13-19(9-11-22(18)33-23)32-26-28-15-20(34-26)14-27-24(30)16-29-12-4-7-25(29)31/h2-3,5-6,9,11,13,15,23H,4,7-8,10,12,14,16H2,1H3,(H,27,30)

Standard InChI Key:  CAFJWFVUPVMRNG-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
    3.9010    0.4475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8991   -0.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1969   -1.5045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1945   -3.0045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8943   -3.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5965   -3.0004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5987   -1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1984    1.4977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4971    0.7454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8506    1.3617    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8505    0.2435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.0959   -1.0529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.6977   -2.4250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8096   -3.6348    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -8.4124   -5.0092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.6051   -5.1409    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5243   -6.2191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.1271   -7.5935    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -9.5844   -7.8905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.7359   -9.3829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.3635   -9.9881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3637   -8.8699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1692   -8.9841    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6298   -0.7359    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 21 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 24  1  0
 28 29  2  0
 18 30  1  0
 30 15  1  0
 13 31  2  0
 31 32  1  0
 32 33  2  0
 33 11  1  0
 33 34  1  0
 34  8  1  0
M  END

Associated Targets(Human)

SLC8A1 Tchem Sodium/calcium exchanger 1 (416 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 477.59Molecular Weight (Monoisotopic): 477.1722AlogP: 4.55#Rotatable Bonds: 7
Polar Surface Area: 80.76Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 12.77CX Basic pKa: CX LogP: 3.86CX LogD: 3.86
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.54Np Likeness Score: -0.93

References

1.  (2014)  Substituted 2-(chroman-6-yloxy)-thiazoles and their use as pharmaceuticals, 

Source

Source(1):