3-(5-{3-[5-(2-Carboxy-ethyl)-thiophen-2-yl]-benzo[g]quinoxalin-2-yl}-thiophen-2-yl)-propionic acid

ID: ALA366201

PubChem CID: 10206548

Max Phase: Preclinical

Molecular Formula: C26H20N2O4S2

Molecular Weight: 488.59

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  O=C(O)CCc1ccc(-c2nc3cc4ccccc4cc3nc2-c2ccc(CCC(=O)O)s2)s1

Standard InChI:  InChI=1S/C26H20N2O4S2/c29-23(30)11-7-17-5-9-21(33-17)25-26(22-10-6-18(34-22)8-12-24(31)32)28-20-14-16-4-2-1-3-15(16)13-19(20)27-25/h1-6,9-10,13-14H,7-8,11-12H2,(H,29,30)(H,31,32)

Standard InChI Key:  YXYLSGIDXPMVNW-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
    2.0167   -0.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0042    0.5833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3042   -0.6667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2917    0.9875    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.7167    1.0083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7375   -0.6542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4792    0.6750    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.8292   -1.4792    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    0.5792    0.5708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5875   -0.2542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8000    1.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4875   -0.3167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6375   -1.6417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0250    1.2958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1250   -0.6750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1333    0.9833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0417   -0.9250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6042    2.0083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0125    0.3875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1417   -3.2250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8458    0.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8458   -0.2625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3542   -0.3667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6542   -3.8917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8417    1.2125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9792   -2.3917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1917    0.4625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8000   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9625   -3.3042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4917    1.0583    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5583   -0.6792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5583    0.9750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2708    0.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2708   -0.2667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  1  2  0
  4  2  2  0
  5  2  1  0
  6  1  1  0
  7  5  1  0
  8  6  1  0
  9 10  1  0
 10  3  1  0
 11  5  2  0
 12  6  2  0
 13  8  1  0
 14  7  1  0
 15 10  2  0
 16  9  2  0
 17 12  1  0
 18 11  1  0
 19 27  1  0
 20 28  1  0
 21 22  1  0
 22 15  1  0
 23 19  2  0
 24 20  2  0
 25 14  1  0
 26 13  1  0
 27 25  1  0
 28 26  1  0
 29 20  1  0
 30 19  1  0
 31 22  2  0
 32 21  2  0
 33 34  2  0
 34 31  1  0
 13 17  2  0
  4  9  1  0
 14 18  2  0
 21 16  1  0
 32 33  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA366201

   3-(5-{3-[5-(2-Carboxy-ethyl)-thiophen-2-yl]-benzo[g]quinoxalin-2-yl}-thiophen-2-yl)-propionic acid

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 488.59

Molecular Weight (Monoisotopic): 488.0864

AlogP: 6.27

#Rotatable Bonds: 8

Polar Surface Area: 100.38

Molecular Species: ACID

HBA: 6

HBD: 2

#RO5 Violations: 1

HBA (Lipinski): 6

HBD (Lipinski): 2

#RO5 Violations (Lipinski): 1

CX Acidic pKa: 4.55

CX Basic pKa: ┄

CX LogP: 6.34

CX LogD: 1.32

Aromatic Rings: 5

Heavy Atoms: 34

QED Weighted: 0.25

Np Likeness Score: -0.45

References

1. Székelyhidi Z, Pató J, Wáczek F, Bánhegyi P, Hegymegi-Barakonyi B, Erös D, Mészáros G, Hollósy F, Hafenbradl D, Obert S, Klebl B, Kéri G, Orfi L..  (2005)  Synthesis of selective SRPK-1 inhibitors: novel tricyclic quinoxaline derivatives.,  15  (13): [PMID:15925511] [10.1016/j.bmcl.2005.04.064]

Source

Source(1):

• Scientific Literature