The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8912224, 335 ID: ALA3662010
PubChem CID: 91754891
Max Phase: Preclinical
Molecular Formula: C23H24N2O4S
Molecular Weight: 424.52
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccccc1C1CCc2cc(Oc3nc(C)c(C(=O)NCCO)s3)ccc2O1
Standard InChI: InChI=1S/C23H24N2O4S/c1-14-5-3-4-6-18(14)20-9-7-16-13-17(8-10-19(16)29-20)28-23-25-15(2)21(30-23)22(27)24-11-12-26/h3-6,8,10,13,20,26H,7,9,11-12H2,1-2H3,(H,24,27)
Standard InChI Key: DMIPPPFIKPSSGE-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
3.9010 0.4475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8991 -0.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1969 -1.5045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1945 -3.0045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8943 -3.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5965 -3.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5987 -1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1984 1.4977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.4971 0.7454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8506 1.3617 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-8.8505 0.2435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.0443 0.3648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.0959 -1.0529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.6298 -0.7359 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-8.6977 -2.4250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.8905 -2.5567 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.8096 -3.6348 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-8.4124 -5.0092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.5243 -6.2191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.0062 -7.3180 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 1 0
17 19 2 0
19 20 1 0
20 15 1 0
19 21 1 0
21 22 2 0
21 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
13 27 2 0
27 28 1 0
28 29 2 0
29 11 1 0
29 30 1 0
30 8 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 424.52Molecular Weight (Monoisotopic): 424.1457AlogP: 4.34#Rotatable Bonds: 6Polar Surface Area: 80.68Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.15CX Basic pKa: ┄CX LogP: 4.09CX LogD: 4.09Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.62Np Likeness Score: -0.59
References 1. (2014) Substituted 2-(chroman-6-yloxy)-thiazoles and their use as pharmaceuticals,